N-Benzyl-9Z,12Z,15Z-octadecatrienamide

Catalog Number	ACM883715182
CAS Number	883715-18-2
Synonyms	(9Z,12Z,15Z)-N-Benzyloctadeca-9,12,15-trienamide
Molecular Weight	367.6
InChI	InChI=1S/C25H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-25(27)26-23-24-20-17-16-18-21-24/h3-4,6-7,9-10,16-18,20-21H,2,5,8,11-15,19,22-23H2,1H3,(H,26,27)/b4-3-,7-6-,10-9-
InChI Key	VCMMYRWIEZCYDK-PDBXOOCHSA-N
Purity	95%+
Complexity	430
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	367.287514804
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NCC1=CC=CC=C1
Monoisotopic Mass	367.287514804
PhysicalState	Oil
Rotatable Bond Count	15
Topological Polar Surface Area	29.1 Ų

Custom Q&A

What is the chemical name of the compound with the synonym N-benzyl-9Z,12Z,15Z-octadecatrienamide?

The chemical name of the compound is N-benzyl-9Z,12Z,15Z-octadecatrienamide.

What are some synonyms for N-benzyl-9Z,12Z,15Z-octadecatrienamide?

Some synonyms for N-benzyl-9Z,12Z,15Z-octadecatrienamide are N-Benzyllinolenamide, N-Benzyllinolenicamide, Macamide Impurity 8, and (9Z,12Z,15Z)-N-(Phenylmethyl)-9,12,15-octadecatrienamide.

What is the CAS number of N-benzyl-9Z,12Z,15Z-octadecatrienamide?

The CAS number of N-benzyl-9Z,12Z,15Z-octadecatrienamide is 883715-18-2.

What is the molecular formula of N-benzyl-9Z,12Z,15Z-octadecatrienamide?

The molecular formula of N-benzyl-9Z,12Z,15Z-octadecatrienamide is C25H37NO.

What is the molecular weight of N-benzyl-9Z,12Z,15Z-octadecatrienamide?

The molecular weight of N-benzyl-9Z,12Z,15Z-octadecatrienamide is 367.57.

What is the predicted boiling point of N-benzyl-9Z,12Z,15Z-octadecatrienamide?

The predicted boiling point of N-benzyl-9Z,12Z,15Z-octadecatrienamide is 534.2±39.0 °C.

What is the predicted density of N-benzyl-9Z,12Z,15Z-octadecatrienamide?

The predicted density of N-benzyl-9Z,12Z,15Z-octadecatrienamide is 0.943±0.06 g/cm3.

At what temperature should N-benzyl-9Z,12Z,15Z-octadecatrienamide be stored?

N-benzyl-9Z,12Z,15Z-octadecatrienamide should be stored at -20°C.

In what solvent is N-benzyl-9Z,12Z,15Z-octadecatrienamide soluble?

N-benzyl-9Z,12Z,15Z-octadecatrienamide is soluble in DMSO.

What is the predicted pKa value of N-benzyl-9Z,12Z,15Z-octadecatrienamide?

The predicted pKa value of N-benzyl-9Z,12Z,15Z-octadecatrienamide is 16.39±0.46.

※ Please kindly note that our products are for research use only.