N-Benzyloctadecenamide

N-Benzyloctadecenamide

Inquiry
Catalog Number ACM101762872
CAS Number 101762-87-2
Synonyms (9Z)-N-(Phenylmethyl)-9-octadecenamide
Molecular Weight 371.6
InChI InChI=1S/C25H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-25(27)26-23-24-20-17-16-18-21-24/h9-10,16-18,20-21H,2-8,11-15,19,22-23H2,1H3,(H,26,27)
InChI Key QHXGFOCPQQADIF-UHFFFAOYSA-N
Melting Point 58-59 °C
Purity 95%+
Complexity 357
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 371.318814931
Heavy Atom Count 27
Hydrogen Bond Acceptor Count 1
Hydrogen Bond Donor Count 1
Monoisotopic Mass 371.318814931
PhysicalState Powder
Rotatable Bond Count 17
Topological Polar Surface Area 29.1 Ų
Custom Q&A

What is the chemical formula for N-Benzyloctadecenamide?

The chemical formula for N-Benzyloctadecenamide is C25H41NO.

What is the molecular weight of N-Benzyloctadecenamide?

The molecular weight of N-Benzyloctadecenamide is 371.6.

What is the CAS number for N-Benzyloctadecenamide?

The CAS number for N-Benzyloctadecenamide is 101762-87-2.

What is the predicted boiling point of N-Benzyloctadecenamide?

The predicted boiling point of N-Benzyloctadecenamide is 534.2±39.0 °C.

What is the predicted pka value for N-Benzyloctadecenamide?

The predicted pka value for N-Benzyloctadecenamide is 16.39±0.46.

What is the predicted density of N-Benzyloctadecenamide?

The predicted density of N-Benzyloctadecenamide is 0.923±0.06 g/cm3.

What is the melting point of N-Benzyloctadecenamide?

The melting point of N-Benzyloctadecenamide is 58-59 °C.

What are some synonyms for N-Benzyloctadecenamide?

Some synonyms for N-Benzyloctadecenamide are (9Z)-N-(Phenylmethyl)-9-octadecenamide and 9-Octadecenamide, N-(phenylmethyl)-, (9Z)-.

How many carbon atoms are present in the molecular structure of N-Benzyloctadecenamide?

There are 25 carbon atoms present in the molecular structure of N-Benzyloctadecenamide.

※ Please kindly note that our products are for research use only.