N-cis-Feruloyltyramine

Catalog Number	ACM80510094
CAS Number	80510-09-4
Synonyms	cis-Feruloyl-p-hydroxybenzenethylamine
Molecular Weight	313.3
InChI	InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5-
InChI Key	NPNNKDMSXVRADT-UITAMQMPSA-N
Melting Point	128-132 °C
Purity	95%+
Complexity	391
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	313.13140809
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	3
Isomeric SMILES	COC1=C(C=CC(=C1)/C=C\C(=O)NCCC2=CC=C(C=C2)O)O
Monoisotopic Mass	313.13140809
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	78.8 Ų

Custom Q&A

What is the chemical name of N-cis-Feruloyltyramine?

The chemical name of N-cis-Feruloyltyramine is cis-N-Feruloyltyramine.

What are some synonyms of N-cis-Feruloyltyramine?

Some synonyms of N-cis-Feruloyltyramine include Z-N-Feruloyltyramine and cis-Feruloyl-p-hydroxybenzenethylamine.

What is the CAS number of N-cis-Feruloyltyramine?

The CAS number of N-cis-Feruloyltyramine is 80510-09-4.

What is the molecular formula of N-cis-Feruloyltyramine?

The molecular formula of N-cis-Feruloyltyramine is C18H19NO4.

What is the molecular weight of N-cis-Feruloyltyramine?

The molecular weight of N-cis-Feruloyltyramine is 313.35.

What is the melting point of N-cis-Feruloyltyramine?

The melting point of N-cis-Feruloyltyramine is 128-132℃ in chloroform methanol.

What is the boiling point of N-cis-Feruloyltyramine?

The boiling point of N-cis-Feruloyltyramine is predicted to be 603.3±55.0 °C.

What is the density of N-cis-Feruloyltyramine?

The density of N-cis-Feruloyltyramine is predicted to be 1.248±0.06 g/cm3.

What is the pka value of N-cis-Feruloyltyramine?

The pka value of N-cis-Feruloyltyramine is predicted to be 9.83±0.31.

How is N-cis-Feruloyltyramine defined according to ChEBI?

N-cis-Feruloyltyramine is defined as a hydroxycinnamic acid according to ChEBI.

※ Please kindly note that our products are for research use only.