N-FeruloyloctopaMine

Catalog Number	ACM66648440
CAS Number	66648-44-0
Synonyms	trans-N-Feruloyl octopamine
Molecular Weight	329.3
InChI	InChI=1S/C18H19NO5/c1-24-17-10-12(2-8-15(17)21)3-9-18(23)19-11-16(22)13-4-6-14(20)7-5-13/h2-10,16,20-22H,11H2,1H3,(H,19,23)/b9-3+
InChI Key	VJSCHQMOTSXAKB-YCRREMRBSA-N
Purity	95%+
Complexity	420
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	329.12632271
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	4
Isomeric SMILES	COC1=C(C=CC(=C1)/C=C/C(=O)NCC(C2=CC=C(C=C2)O)O)O
Monoisotopic Mass	329.12632271
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	99 Ų

Custom Q&A

What is the chemical formula of N-FeruloyloctopaMine?

The chemical formula of N-FeruloyloctopaMine is C18H19NO5.

What is the molecular weight of N-FeruloyloctopaMine?

The molecular weight of N-FeruloyloctopaMine is 329.35 g/mol.

What is the boiling point of N-FeruloyloctopaMine?

The boiling point of N-FeruloyloctopaMine is predicted to be 652.5±55.0 °C.

What is the density of N-FeruloyloctopaMine?

The density of N-FeruloyloctopaMine is predicted to be 1.321±0.06 g/cm3.

How should N-FeruloyloctopaMine be stored?

N-FeruloyloctopaMine should be stored at 4°C and protected from light.

What is the pKa value of N-FeruloyloctopaMine?

The pKa value of N-FeruloyloctopaMine is predicted to be 9.82±0.31.

What is N-FeruloyloctopaMine used for?

N-FeruloyloctopaMine is widely used in the fields of medicine and chemical industry as a ferulic acid amide compound.

How is N-FeruloyloctopaMine synthesized?

N-FeruloyloctopaMine is prepared by reacting ferulic acid and octopamine with N,N'-dicyclohexylcarbonimide (DCC) as dehydrating agent and 4-dimethylaminopyridine (DMAP) as catalyst.

What is the biological activity of N-FeruloyloctopaMine?

N-FeruloyloctopaMine, isolated from Garlic bark, is an antioxidant ingredient that significantly reduces Akt and p38 MAPK phosphorylation levels.

What are the raw materials used in the synthesis of N-FeruloyloctopaMine?

The raw materials used in the synthesis of N-FeruloyloctopaMine are 2-Propenoic acid, octopamine, ferulic acid, and vanillin.

※ Please kindly note that our products are for research use only.