(-)-N-Formylcytisine

Catalog Number	ACM53007060
CAS Number	53007-06-0
Synonyms	O-Formylcytisine
Molecular Weight	218.25
InChI	InChI=1S/C12H14N2O2/c15-8-13-5-9-4-10(7-13)11-2-1-3-12(16)14(11)6-9/h1-3,8-10H,4-7H2/t9-,10+/m0/s1
InChI Key	PCYQRXYBKKZUSR-VHSXEESVSA-N
Purity	90%+
Complexity	400
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	218.105527694
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	C1[C@H]2CN(C[C@@H]1C3=CC=CC(=O)N3C2)C=O
Monoisotopic Mass	218.105527694
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	40.6 Ų

Custom Q&A

What is the chemical name of the compound N-Formylcytisine?

The chemical name of the compound N-Formylcytisine is [1R,(-)]-3-Formyl-1,2,3,4,5,6-hexahydro-1α,5α-methano-8H-pyrido[1,2-a][1,5]diazocine-8-one.

What is the molecular formula of N-Formylcytisine?

The molecular formula of N-Formylcytisine is C12H14N2O2.

What is the boiling point of N-Formylcytisine?

The boiling point of N-Formylcytisine is predicted to be 512.8±49.0 °C.

In what form does N-Formylcytisine exist at room temperature?

N-Formylcytisine exists in solid form at room temperature.

What is the color of N-Formylcytisine?

The color of N-Formylcytisine is white to off-white.

From where has N-Formylcytisine been isolated?

N-Formylcytisine has been recently isolated from Thermopsis chinensis.

What is the specific rotation of N-Formylcytisine?

The specific rotation of N-Formylcytisine is [α]20D- 233° (c 0.5, EtOH).

What are the solubility properties of N-Formylcytisine?

N-Formylcytisine is slightly soluble in chloroform, ethanol, and methanol.

How can N-Formylcytisine be stored?

N-Formylcytisine can be stored in a hygroscopic, -20°C freezer, under an inert atmosphere.

For what purpose can N-Formylcytisine be used as a ligand?

N-Formylcytisine can be used as a ligand for neuronal nicotine receptors.

※ Please kindly note that our products are for research use only.