N-Methylcalycinine

Catalog Number	ACM86537668
CAS Number	86537-66-8
Molecular Weight	325.4
InChI	InChI=1S/C19H19NO4/c1-20-4-3-10-7-15-19(24-9-23-15)18-16(10)13(20)6-11-5-12(22-2)8-14(21)17(11)18/h5,7-8,13,21H,3-4,6,9H2,1-2H3/t13-/m1/s1
InChI Key	SFOMHAXOBRLRFH-CYBMUJFWSA-N
Purity	95%+
Complexity	488
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	325.13140809
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1CCC2=CC3=C(C4=C2[C@H]1CC5=C4C(=CC(=C5)OC)O)OCO3
Monoisotopic Mass	325.13140809
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	51.2 Ų

Custom Q&A

What is the chemical formula for N-Methylcalycinine?

The chemical formula for N-Methylcalycinine is C19H19NO4.

What is the molecular weight of N-Methylcalycinine?

The molecular weight of N-Methylcalycinine is 325.36.

What is the CAS number for N-Methylcalycinine?

The CAS number for N-Methylcalycinine is 86537-66-8.

What are the synonyms for N-Methylcalycinine?

The synonyms for N-Methylcalycinine are 5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-12-ol and 6,7,7a,8-tetrahydro-10-methoxy-7-methyl-, (7aR)-.

What is the predicted boiling point of N-Methylcalycinine?

The predicted boiling point of N-Methylcalycinine is 531.9±50.0 °C.

What is the predicted density of N-Methylcalycinine?

The predicted density of N-Methylcalycinine is 1.342±0.06 g/cm3.

What is the predicted pKa value of N-Methylcalycinine?

The predicted pKa value of N-Methylcalycinine is 9.03±0.20.

How many carbon atoms are present in the molecular structure of N-Methylcalycinine?

There are 19 carbon atoms present in the molecular structure of N-Methylcalycinine.

In what form is N-Methylcalycinine commonly found?

N-Methylcalycinine is commonly found in the form of a specific chemical compound.

What is the general category of N-Methylcalycinine?

N-Methylcalycinine belongs to the category of organic compounds.

※ Please kindly note that our products are for research use only.