N-Methylcorydaldine

N-Methylcorydaldine

Inquiry
Catalog Number ACM6514052
CAS Number 6514-05-2
Structure
Synonyms 3,4-Dihydro-6,7-dimethoxy-2-methyl-1(2H)-isoquinolinone
Molecular Weight 221.25
InChI InChI=1S/C12H15NO3/c1-13-5-4-8-6-10(15-2)11(16-3)7-9(8)12(13)14/h6-7H,4-5H2,1-3H3
InChI Key BDIZBBGNYDRCCA-UHFFFAOYSA-N
Melting Point 124-125 °C
Purity 95%+
Complexity 269
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 221.10519334
Heavy Atom Count 16
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 0
Monoisotopic Mass 221.10519334
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 38.8 Ų
Custom Q&A

What is the chemical name of N-Methylcorydaldine?

The chemical name of N-Methylcorydaldine is 2-Methyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-1-one.

What is another name for N-Methylcorydaldine?

N-Methylcorydaldine is also known as 3,4-Dihydro-6,7-dimethoxy-2-methyl-1(2H)-isoquinolinone.

What is the CAS number of N-Methylcorydaldine?

The CAS number of N-Methylcorydaldine is 6514-05-2.

What is the molecular formula of N-Methylcorydaldine?

The molecular formula of N-Methylcorydaldine is C12H15NO3.

What is the molecular weight of N-Methylcorydaldine?

The molecular weight of N-Methylcorydaldine is 221.25.

What is the melting point of N-Methylcorydaldine?

The melting point of N-Methylcorydaldine is 124-5°C.

What is the boiling point of N-Methylcorydaldine?

The boiling point of N-Methylcorydaldine is predicted to be 400.4±45.0 °C.

In what solvents is N-Methylcorydaldine soluble?

N-Methylcorydaldine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

Where has N-Methylcorydaldine been isolated from?

N-Methylcorydaldine has been isolated from Thalictrum fendleri.

What is the role of N-Methylcorydaldine as per ChEBI?

N-Methylcorydaldine is a quinolone and has a role as a metabolite.

※ Please kindly note that our products are for research use only.