N-Methylflindersine

Catalog Number	ACM50333136
CAS Number	50333-13-6
Structure
Synonyms	2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinoline-5-one
Molecular Weight	241.28
InChI	InChI=1S/C15H15NO2/c1-15(2)9-8-11-13(18-15)10-6-4-5-7-12(10)16(3)14(11)17/h4-9H,1-3H3
InChI Key	RJZFGBNKPOVCHQ-UHFFFAOYSA-N
Melting Point	85 °C
Purity	95%+
Complexity	447
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	241.110278721
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	241.110278721
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the chemical structure of N-Methylflindersine?

The chemical structure of N-Methylflindersine is C15H15NO2.

What are some synonyms for N-Methylflindersine?

Some synonyms for N-Methylflindersine are 2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinoline-5-one, NSC 347659, and 5H-Pyrano[3,2-c]quinolin-5-one.

What is the melting point of N-Methylflindersine?

The melting point of N-Methylflindersine is 85℃.

What is the boiling point of N-Methylflindersine?

The boiling point of N-Methylflindersine is 365.8±42.0 °C.

What is the density of N-Methylflindersine?

The density of N-Methylflindersine is 1.22±0.1 g/cm3.

What is the pKa value of N-Methylflindersine?

The pKa value of N-Methylflindersine is 0.40±0.40.

How is N-Methylflindersine defined in ChEBI?

N-Methylflindersine is defined in ChEBI as an oxacycle, an organic heterotricyclic compound, and an organonitrogen heterocyclic compound.

What is the molecular weight of N-Methylflindersine?

The molecular weight of N-Methylflindersine is 241.29 g/mol.

What is the CAS number for N-Methylflindersine?

The CAS number for N-Methylflindersine is 50333-13-6.

How is N-Methylflindersine used?

N-Methylflindersine is used as an inhibitor in various processes.

※ Please kindly note that our products are for research use only.