N-Methylnuciferine

Catalog Number	ACM754919249
CAS Number	754919-24-9
Synonyms	(R)-5,6,6a,7-Tetrahydro-1,2-dimethoxy-6,6-dimethyl-4H-dibenzo[de,g]quinolinium
Molecular Weight	310.4
InChI	InChI=1S/C20H24NO2/c1-21(2)10-9-14-12-17(22-3)20(23-4)19-15-8-6-5-7-13(15)11-16(21)18(14)19/h5-8,12,16H,9-11H2,1-4H3/q+1/t16-/m1/s1
InChI Key	NJSAZXBJMATEKS-MRXNPFEDSA-N
Purity	95%+
Complexity	437
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	310.180704008
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[N+]1(CCC2=CC(=C(C3=C2[C@H]1CC4=CC=CC=C43)OC)OC)C
Monoisotopic Mass	310.180704008
PhysicalState	Oil
Rotatable Bond Count	2
Topological Polar Surface Area	18.5 Ų

Custom Q&A

What is the chemical name of N-Methylnuciferine?

(R)-5,6,6a,7-Tetrahydro-1,2-dimethoxy-6,6-dimethyl-4H-dibenzo[de,g]quinolinium

What are some synonyms for N-Methylnuciferine?

N-Methamphetamine, N-Methylnuciferine, (R)-1,2-Dimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium

What is the CAS number for N-Methylnuciferine?

754919-24-9

What is the molecular formula of N-Methylnuciferine?

C20H24NO2+

What is the molecular weight of N-Methylnuciferine?

310.42

What is the primary usage of N-Methylnuciferine stated in the reference?

It can be used for content determination/identification/pharmacological experiments, etc.

Where is N-Methylnuciferine sourced from?

Lotus Plumule

In what way does N-Methylnuciferine improve behavior?

It improves lipopolysaccharide-induced depression-like behavior.

What experiments can N-Methylnuciferine be used for?

Pharmacological experiments

What is the chemical structure of N-Methylnuciferine?

(R)-5,6,6a,7-Tetrahydro-1,2-dimethoxy-6,6-dimethyl-4H-dibenzo[de,g]quinolinium

※ Please kindly note that our products are for research use only.