(-)-N-Methylsedridine

Catalog Number	ACM41447158
CAS Number	41447-15-8
Molecular Weight	157.25
InChI	InChI=1S/C9H19NO/c1-8(11)7-9-5-3-4-6-10(9)2/h8-9,11H,3-7H2,1-2H3/t8-,9-/m0/s1
InChI Key	JOHKCJPJMSCFBX-IUCAKERBSA-N
Purity	95%+
Complexity	116
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	157.14666423
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@@H](C[C@@H]1CCCCN1C)O
Monoisotopic Mass	157.14666423
PhysicalState	Oil
Rotatable Bond Count	2
Topological Polar Surface Area	23.5 Ų

Custom Q&A

What is the chemical formula for (-)-N-Methylsedridine?

The chemical formula for (-)-N-Methylsedridine is C9H19NO.

What is the molecular weight of (-)-N-Methylsedridine?

The molecular weight of (-)-N-Methylsedridine is 157.26 g/mol.

What is the CAS number for (-)-N-Methylsedridine?

The CAS number for (-)-N-Methylsedridine is 41447-15-8.

What are some synonyms for (-)-N-Methylsedridine?

Some synonyms for (-)-N-Methylsedridine are 2-Piperidineethanol, α,1-dimethyl-, (αS,2S)-.

What is the boiling point of (-)-N-Methylsedridine?

The predicted boiling point of (-)-N-Methylsedridine is 223.3±13.0 °C.

What is the predicted density of (-)-N-Methylsedridine?

The predicted density of (-)-N-Methylsedridine is 0.927±0.06 g/cm3.

What is the predicted pKa of (-)-N-Methylsedridine?

The predicted pKa of (-)-N-Methylsedridine is 15.22±0.20.

How is (-)-N-Methylsedridine predicted to behave at its boiling point?

(-)-N-Methylsedridine is predicted to boil at 223.3±13.0 °C.

Why is pKa an important property to predict in (-)-N-Methylsedridine?

pKa is important in predicting the ionization behavior of (-)-N-Methylsedridine and its reactivity in various chemical reactions.

※ Please kindly note that our products are for research use only.