N-p-Coumaroyl-N'-caffeoylputrescine

Catalog Number	ACM1138156770
CAS Number	1138156-77-0
Structure
Synonyms	3-(3,4-Dihydroxyphenyl)-N-[4-[[3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]butyl]-2-propenamide
Molecular Weight	396.4
Molecular Formula	C22H24N2O5
InChI	InChI=1S/C22H24N2O5/c25-18-8-3-16(4-9-18)6-11-21(28)23-13-1-2-14-24-22(29)12-7-17-5-10-19(26)20(27)15-17/h3-12,15,25-27H,1-2,13-14H2,(H,23,28)(H,24,29)/b11-6+,12-7+
InChI Key	NDUQQMKMMARZRU-GNXRPPCSSA-N
Purity	95%+
Density	5mg 10mg 20 mg
Complexity	570
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	396.16852187
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	5
Isomeric SMILES	C1=CC(=CC=C1/C=C/C(=O)NCCCCNC(=O)/C=C/C2=CC(=C(C=C2)O)O)O
Monoisotopic Mass	396.16852187
PhysicalState	Powder
Rotatable Bond Count	9
Topological Polar Surface Area	119 Ų

Custom Q&A

What is the molecular formula for N-p-coumaroyl-N'-caffeoylputrescine?

The molecular formula for N-p-coumaroyl-N'-caffeoylputrescine is C22H24N2O5.

What is the molecular weight of N-p-coumaroyl-N'-caffeoylputrescine?

The molecular weight of N-p-coumaroyl-N'-caffeoylputrescine is 396.44.

What is the CAS number for N-p-coumaroyl-N'-caffeoylputrescine?

The CAS number for N-p-coumaroyl-N'-caffeoylputrescine is 1138156-77-0.

What is the predicted boiling point of N-p-coumaroyl-N'-caffeoylputrescine?

The predicted boiling point of N-p-coumaroyl-N'-caffeoylputrescine is 784.9±60.0 °C.

What is the predicted density of N-p-coumaroyl-N'-caffeoylputrescine?

The predicted density of N-p-coumaroyl-N'-caffeoylputrescine is 1.297±0.06 g/cm3.

What is the predicted pKa value of N-p-coumaroyl-N'-caffeoylputrescine?

The predicted pKa value of N-p-coumaroyl-N'-caffeoylputrescine is 9.42±0.10.

What are the synonyms for N-p-coumaroyl-N'-caffeoylputrescine?

Some synonyms for N-p-coumaroyl-N'-caffeoylputrescine are 3-(3,4-Dihydroxyphenyl)-N-[4-[[3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]butyl]-2-propenamide and (2E)-3-(3,4-Dihydroxyphenyl)-N-(4-{[(2E)-3-(4-hydroxyphenyl)-2-propenoyl]amino}butyl)acrylamide.

What are the chemical properties of N-p-coumaroyl-N'-caffeoylputrescine?

The chemical properties of N-p-coumaroyl-N'-caffeoylputrescine include a predicted boiling point, density, and pKa value.

What is the significance of N-p-coumaroyl-N'-caffeoylputrescine?

N-p-coumaroyl-N'-caffeoylputrescine is a specific compound with potential biological activities that may be of interest for research or pharmaceutical development.

※ Please kindly note that our products are for research use only.