N-(p-Coumaroyl) Serotonin

Catalog Number	ACM68573240-1
CAS Number	68573-24-0
Structure
Synonyms	N-[2-(5-Hydroxy-1H-indol-3-yl)ethyl]-3-(4-hydroxyphenyl)-2-propenamide
Molecular Weight	322.4
Molecular Formula	C19H18N2O3
InChI	InChI=1S/C19H18N2O3/c22-15-4-1-13(2-5-15)3-8-19(24)20-10-9-14-12-21-18-7-6-16(23)11-17(14)18/h1-8,11-12,21-23H,9-10H2,(H,20,24)/b8-3+
InChI Key	WLZPAFGVOWCVMG-FPYGCLRLSA-N
Flash Point	373.6°C
Purity	95%+
Density	1.346 g/cm³
Complexity	446
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	322.13174244
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	4
Isomeric SMILES	C1=CC(=CC=C1/C=C/C(=O)NCCC2=CNC3=C2C=C(C=C3)O)O
Monoisotopic Mass	322.13174244
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	85.4 Ų

Custom Q&A

What is the CAS number of N-(p-Coumaroyl) Serotonin?

The CAS number of N-(p-Coumaroyl) Serotonin is 68573-24-0.

What is the molecular formula of N-(p-Coumaroyl) Serotonin?

The molecular formula of N-(p-Coumaroyl) Serotonin is C19H18N2O3.

What is the melting point of N-(p-Coumaroyl) Serotonin?

The melting point of N-(p-Coumaroyl) Serotonin is 192-194°C.

What are some of the chemical properties of N-(p-Coumaroyl) Serotonin?

Some of the chemical properties of N-(p-Coumaroyl) Serotonin include being a tan solid, and having a pale yellow to beige color.

In which types of compounds does N-(p-Coumaroyl) Serotonin fall under?

N-(p-Coumaroyl) Serotonin falls under Aromatics Compounds, Aromatics, and Heterocycles.

How is N-(p-Coumaroyl) Serotonin used in terms of its antioxidative properties?

N-(p-Coumaroyl) Serotonin is an antioxidative phenolic naturally found in plants, including safflower seed and millet grain. It ameliorates atherosclerosis in vivo and suppresses inflammatory cytokine generation.

What is the storage temperature recommendation for N-(p-Coumaroyl) Serotonin?

The storage temperature recommendation for N-(p-Coumaroyl) Serotonin is a refrigerator.

What is the solubility of N-(p-Coumaroyl) Serotonin in DMSO and Methanol?

N-(p-Coumaroyl) Serotonin is slightly soluble in DMSO and Methanol.

What is the predicted boiling point of N-(p-Coumaroyl) Serotonin?

The predicted boiling point of N-(p-Coumaroyl) Serotonin is 694.2±55.0°C.

What are some of the observed effects of N-(p-Coumaroyl) Serotonin on vascular smooth muscle cells in vitro?

N-(p-Coumaroyl) Serotonin promotes relaxation of vascular smooth muscle cells in vitro, as well as augmenting fibroblast proliferation.

※ Please kindly note that our products are for research use only.