N-Phenethylcinnamamide

Catalog Number	ACM103188438
CAS Number	103188-43-8
Structure
Molecular Weight	251.32
InChI	InChI=1S/C17H17NO/c19-17(12-11-15-7-3-1-4-8-15)18-14-13-16-9-5-2-6-10-16/h1-12H,13-14H2,(H,18,19)
InChI Key	BOSUEWCVNFFBGV-UHFFFAOYSA-N
Melting Point	161-165 °C
Purity	95%+
Complexity	286
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	251.131014166
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	1
Monoisotopic Mass	251.131014166
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	29.1 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 103188-43-8?

The chemical name of the compound is 2-PropenaMide, 3-phenyl-N-(2-phenylethyl)-, (2E)-, also known as N-Phenethylcinnamamide.

What is the molecular formula of N-Phenethylcinnamamide?

The molecular formula is C17H17NO.

What is the molecular weight of N-Phenethylcinnamamide?

The molecular weight is 251.32298 g/mol.

What is the melting point of N-Phenethylcinnamamide?

The melting point is 126-127 °C.

In what type of solvents does N-Phenethylcinnamamide have a melting point of 126-127 °C?

It melts in dichloromethane (75-09-2) and hexane (110-54-3).

What is the predicted boiling point of N-Phenethylcinnamamide?

The predicted boiling point is 477.4±38.0 °C.

What is the predicted density of N-Phenethylcinnamamide?

The predicted density is 1.092±0.06 g/cm3.

What is the predicted pka value of N-Phenethylcinnamamide?

The predicted pka value is 15.02±0.46.

What are some synonyms of N-Phenethylcinnamamide?

Some synonyms include 2-PropenaMide, 3-phenyl-N-(2-phenylethyl)- and (2E)-.

※ Please kindly note that our products are for research use only.