N-Trans-p-coumaroyloctopamine

Catalog Number	ACM66648451
CAS Number	66648-45-1
Synonyms	N-p-Coumaroyloctopamine
Molecular Weight	299.32
InChI	InChI=1S/C17H17NO4/c19-14-6-1-12(2-7-14)3-10-17(22)18-11-16(21)13-4-8-15(20)9-5-13/h1-10,16,19-21H,11H2,(H,18,22)/b10-3+
InChI Key	VATOSFCFMOPAHX-XCVCLJGOSA-N
Purity	95%+
Complexity	369
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	299.11575802
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	4
Isomeric SMILES	C1=CC(=CC=C1/C=C/C(=O)NCC(C2=CC=C(C=C2)O)O)O
Monoisotopic Mass	299.11575802
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	89.8 Ų

Custom Q&A

What is the molecular formula of N-trans-p-coumaroyloctopamine?

The molecular formula of N-trans-p-coumaroyloctopamine is C17H17NO4.

What is the MW of N-trans-p-coumaroyloctopamine?

The MW of N-trans-p-coumaroyloctopamine is 299.32 g/mol.

What is the CAS number of N-trans-p-coumaroyloctopamine?

The CAS number of N-trans-p-coumaroyloctopamine is 66648-45-1.

What are the chemical properties of N-trans-p-coumaroyloctopamine?

The boiling point of N-trans-p-coumaroyloctopamine is 638.9±55.0 °C, and the density is 1.329±0.06 g/cm3. The pka is 9.76±0.26.

What are the synonyms of N-trans-p-coumaroyloctopamine?

The synonyms of N-trans-p-coumaroyloctopamine include trans-N-(p-Coumaroyl)octopamine and Octopamine Impurity 11.

How is N-trans-p-coumaroyloctopamine used in synthesis?

N-trans-p-coumaroyloctopamine is a member of styrenes, according to ChEBI.

What is the predicted boiling point of N-trans-p-coumaroyloctopamine?

The predicted boiling point of N-trans-p-coumaroyloctopamine is 638.9±55.0 °C.

What is the predicted density of N-trans-p-coumaroyloctopamine?

The predicted density of N-trans-p-coumaroyloctopamine is 1.329±0.06 g/cm3.

What is the predicted pka of N-trans-p-coumaroyloctopamine?

The predicted pka of N-trans-p-coumaroyloctopamine is 9.76±0.26.

※ Please kindly note that our products are for research use only.