N-Trans-sinapoyltyramine

Catalog Number	ACM200125117
CAS Number	200125-11-7
Synonyms	N-trans-impressionability
Molecular Weight	343.4
InChI	InChI=1S/C19H21NO5/c1-24-16-11-14(12-17(25-2)19(16)23)5-8-18(22)20-10-9-13-3-6-15(21)7-4-13/h3-8,11-12,21,23H,9-10H2,1-2H3,(H,20,22)/b8-5+
InChI Key	IEDBNTAKVGBZEP-VMPITWQZSA-N
Purity	95%+
Complexity	420
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	343.14197277
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	3
Isomeric SMILES	COC1=CC(=CC(=C1O)OC)/C=C/C(=O)NCCC2=CC=C(C=C2)O
Monoisotopic Mass	343.14197277
PhysicalState	Powder
Rotatable Bond Count	7
Topological Polar Surface Area	88 Ų

Custom Q&A

What is the product name of N-trans-Sinapoyltyramine?

The product name of N-trans-Sinapoyltyramine is N-trans-Sinapoyltyramine.

What are some synonyms for N-trans-Sinapoyltyramine?

Some synonyms for N-trans-Sinapoyltyramine are N-trans-Impressionability, N trans Sinapoyltyramine, NtransSinapoyltyramine, and 2-Propenamide, 3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-, (2E)-.

What is the CAS number for N-trans-Sinapoyltyramine?

The CAS number for N-trans-Sinapoyltyramine is 200125-11-7.

What is the molecular formula and molecular weight of N-trans-Sinapoyltyramine?

The molecular formula of N-trans-Sinapoyltyramine is C19H21NO5 and the molecular weight is 343.37.

What is the predicted boiling point of N-trans-Sinapoyltyramine?

The predicted boiling point of N-trans-Sinapoyltyramine is 624.6±55.0 °C.

What is the predicted density of N-trans-Sinapoyltyramine?

The predicted density of N-trans-Sinapoyltyramine is 1.248±0.06 g/cm3.

What is the predicted pka value of N-trans-Sinapoyltyramine?

The predicted pka value of N-trans-Sinapoyltyramine is 9.85±0.36.

How is N-trans-sinapoyltyramine classified in ChEBI?

N-trans-sinapoyltyramine is classified as a hydroxycinnamic acid in ChEBI.

What role does N-trans-sinapoyltyramine play as?

N-trans-sinapoyltyramine has a role as a metabolite.

What is the chemical structure of N-trans-sinapoyltyramine?

The chemical structure of N-trans-sinapoyltyramine is represented by the molecular formula C19H21NO5.

※ Please kindly note that our products are for research use only.