N1,N5,N10-(Z)-Tri-p-coumaroylspermidine

N1,N5,N10-(Z)-Tri-p-coumaroylspermidine

Inquiry
Catalog Number ACM131086787
CAS Number 131086-78-7
Molecular Weight 583.7
InChI InChI=1S/C34H37N3O6/c38-29-13-4-26(5-14-29)10-19-32(41)35-22-1-2-24-37(34(43)21-12-28-8-17-31(40)18-9-28)25-3-23-36-33(42)20-11-27-6-15-30(39)16-7-27/h4-21,38-40H,1-3,22-25H2,(H,35,41)(H,36,42)
InChI Key PFDVWJCSCYDRMZ-UHFFFAOYSA-N
Melting Point 176-180 °C
Purity 95%+
Complexity 926
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 583.26823591
Heavy Atom Count 43
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 5
Monoisotopic Mass 583.26823591
PhysicalState Powder
Rotatable Bond Count 15
Topological Polar Surface Area 139 Ų
Custom Q&A

What is the chemical name for tricoumaroyl spermidine?

The chemical name for tricoumaroyl spermidine is N1,N5,N10-(Z)-tri-p-coumaroylspermidine.

What is the CAS number for tricoumaroyl spermidine?

The CAS number for tricoumaroyl spermidine is 131086-78-7.

What is the molecular formula of tricoumaroyl spermidine?

The molecular formula of tricoumaroyl spermidine is C34H37N3O6.

What is the melting point of tricoumaroyl spermidine?

The melting point of tricoumaroyl spermidine is 176-180 °C.

What is the predicted boiling point of tricoumaroyl spermidine?

The predicted boiling point of tricoumaroyl spermidine is 954.2±65.0 °C.

What is the predicted density of tricoumaroyl spermidine?

The predicted density of tricoumaroyl spermidine is 1.265±0.06 g/cm3.

What is the pKa value of tricoumaroyl spermidine?

The pKa value of tricoumaroyl spermidine is 9.77±0.15.

How is tricoumaroyl spermidine defined in ChEBI?

Tricoumaroyl spermidine is defined in ChEBI as a spermidine hydroxycinnamic acid conjugate in which each nitrogen of spermidine has entered into amide bond formation with a molecule of 4-coumaric acid.

What is tricoumaroyl spermidine functionally related to?

Tricoumaroyl spermidine is functionally related to 4-coumaric acid.

How many nitrogen atoms in spermidine are involved in amide bond formation with 4-coumaric acid in tricoumaroyl spermidine?

In tricoumaroyl spermidine, each nitrogen of spermidine has entered into amide bond formation with a molecule of 4-coumaric acid.

※ Please kindly note that our products are for research use only.