N9-Methylharman

Catalog Number	ACM16498649
CAS Number	16498-64-9
Molecular Weight	196.25
InChI	InChI=1S/C13H12N2/c1-9-13-11(7-8-14-9)10-5-3-4-6-12(10)15(13)2/h3-8H,1-2H3
InChI Key	LQSZHLJVECITAY-UHFFFAOYSA-N
Purity	95%+
Complexity	241
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	196.100048391
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	0
Monoisotopic Mass	196.100048391
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	17.8 Ų

Custom Q&A

What is the molecular formula of N9-Methylharman?

The molecular formula of N9-Methylharman is C13H12N2.

What is the molecular weight of N9-Methylharman?

The molecular weight of N9-Methylharman is 196.25 g/mol.

What is the CAS number of N9-Methylharman?

The CAS number of N9-Methylharman is 16498-64-9.

What is the melting point of N9-Methylharman?

The melting point of N9-Methylharman is 102-103 °C.

What is the boiling point of N9-Methylharman?

The boiling point of N9-Methylharman is 110-120 °C at a pressure of 0.01 Torr.

What is the predicted density of N9-Methylharman?

The predicted density of N9-Methylharman is 1.15 ± 0.1 g/cm3.

What is the predicted pKa value of N9-Methylharman?

The predicted pKa value of N9-Methylharman is 8.98 ± 0.30.

Is N9-Methylharman also known by any other names?

Yes, N9-Methylharman is also known as N9-Methylharmane and 9H-Pyrido[3,4-b]indole, 1,9-dimethyl-.

What is the chemical formula for N9-Methylharman?

The chemical formula for N9-Methylharman is C13H12N2.

※ Please kindly note that our products are for research use only.