Nantenine

Catalog Number	ACM2565017
CAS Number	2565-01-7
Synonyms	O-Methyldomesticine
Molecular Weight	339.4
InChI	InChI=1S/C20H21NO4/c1-21-5-4-11-7-17(22-2)20(23-3)19-13-9-16-15(24-10-25-16)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3/t14-/m0/s1
InChI Key	WSVWKHTVFGTTKJ-AWEZNQCLSA-N
Melting Point	138-139 °C
Purity	95%+
Complexity	502
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	339.14705815
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=CC5=C(C=C43)OCO5)OC)OC
Monoisotopic Mass	339.14705815
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	40.2 Ų

Custom Q&A

What is the chemical name of O-METHYLDOMESTICINE?

The chemical name of O-METHYLDOMESTICINE is nantenine.

What are some other synonyms for O-METHYLDOMESTICINE?

Some other synonyms for O-METHYLDOMESTICINE are ORTHO-METHYLDOMESTICINE and Domestine.

What is the molecular formula of O-METHYLDOMESTICINE?

The molecular formula of O-METHYLDOMESTICINE is C20H21NO4.

What is the molecular weight of O-METHYLDOMESTICINE?

The molecular weight of O-METHYLDOMESTICINE is 339.39.

What is the melting point of O-METHYLDOMESTICINE?

The melting point of O-METHYLDOMESTICINE is 138-9°C.

What is the boiling point of O-METHYLDOMESTICINE?

The predicted boiling point of O-METHYLDOMESTICINE is 487.5±45.0 °C.

What is the density of O-METHYLDOMESTICINE?

The predicted density of O-METHYLDOMESTICINE is 1.266±0.06 g/cm3.

From where has O-METHYLDOMESTICINE been isolated?

O-METHYLDOMESTICINE has been isolated from the seeds of Nandina domestica L. and more recently from Cassytha filiformis.

What is the optical rotation of O-METHYLDOMESTICINE?

The base is dextrorotatory with an optical rotation of [Q]b8 + 101° (CHC13).

What other natural products is O-METHYLDOMESTICINE found in?

O-METHYLDOMESTICINE is found in Corydalis cava and Nandina domestica according to ChEBI.

※ Please kindly note that our products are for research use only.