Napelline

Catalog Number	ACM5008526
CAS Number	5008-52-6
Structure
Molecular Weight	359.5
Molecular Formula	C22H33NO3
InChI	InChI=1S/C22H33NO3/c1-4-23-10-20(3)6-5-17(25)22-15(20)7-13(18(22)23)21-9-12(11(2)19(21)26)14(24)8-16(21)22/h12-19,24-26H,2,4-10H2,1,3H3/t12,13,14-,15,16,17-,18+,19+,20-,21-,22/m0/s1
InChI Key	AZAZKLKDEOMJBJ-KSCSQDNTSA-N
Melting Point	149 °C
Purity	90%+
Complexity	695
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	359.24604391
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	3
Isomeric SMILES	CCN1C[C@@]2(CC[C@@H](C34[C@H]1C(CC23)[C@]56C4C[C@@H](C(C5)C(=C)[C@H]6O)O)O)C
Monoisotopic Mass	359.24604391
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	63.9 Ų

Custom Q&A

What is the chemical name of the compound known as Napelline?

The chemical name of Napelline is 21-ETHYL-4-METHYL-16-METHYLENE-7,20-CYCLOVEATCHANE-1,12-15-TRIOL.

What is the molecular formula of Napelline?

The molecular formula of Napelline is C22H33NO3.

What is the molecular weight of Napelline?

The molecular weight of Napelline is 359.5.

What is the melting point of Napelline?

The melting point of Napelline is 166°C.

Where has Napelline been isolated from?

Napelline has been isolated from Aconitum karakolicum.

How was the structure of Napelline determined?

The structure of Napelline was determined based on chemical analysis and spectroscopic evidence.

What type of alkaloid is Napelline?

Napelline is an aconine alkaloid.

What is another name for Napelline?

Napelline is also known as LUCICULINE.

What is the reference for the isolation of Napelline?

The reference for the isolation of Napelline is SuItankhodzhaev, Yunusov, Yunusov, Khim. Prir. Soedin., 9, 127, 199 (1973).

What species does Napelline belong to?

Napelline belongs to the species Aconitum karakolicum.

※ Please kindly note that our products are for research use only.