Nb-Feruloyltryptamine

Catalog Number	ACM53905138
CAS Number	53905-13-8
Synonyms	3-(4-Hydroxy-3-methoxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]-2-propenamide
Molecular Weight	336.4
InChI	InChI=1S/C20H20N2O3/c1-25-19-12-14(6-8-18(19)23)7-9-20(24)21-11-10-15-13-22-17-5-3-2-4-16(15)17/h2-9,12-13,22-23H,10-11H2,1H3,(H,21,24)/b9-7+
InChI Key	LWRQDNUXWLIWDB-VQHVLOKHSA-N
Melting Point	163-165 °C
Purity	95%+
Complexity	468
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	336.1473925
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Isomeric SMILES	COC1=C(C=CC(=C1)/C=C/C(=O)NCCC2=CNC3=CC=CC=C32)O
Monoisotopic Mass	336.1473925
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	74.4 Ų

Custom Q&A

What is the chemical formula of Nb-Feruloyltryptamine?

The chemical formula of Nb-Feruloyltryptamine is C20H20N2O3.

What is the molecular weight of Nb-Feruloyltryptamine?

The molecular weight of Nb-Feruloyltryptamine is 336.38.

What is the melting point of Nb-Feruloyltryptamine?

The melting point of Nb-Feruloyltryptamine is 163-165 °C.

What is the boiling point of Nb-Feruloyltryptamine?

The boiling point of Nb-Feruloyltryptamine is 650.6±55.0 °C.

What is the density of Nb-Feruloyltryptamine?

The density of Nb-Feruloyltryptamine is 1.269±0.06 g/cm3.

What is the pka value of Nb-Feruloyltryptamine?

The pka value of Nb-Feruloyltryptamine is 9.78±0.35.

How is Nb-Feruloyltryptamine used in synthesis?

Nb-Feruloyltryptamine is used as a hydroxycinnamic acid in synthesis.

What are the synonyms of Nb-Feruloyltryptamine?

The synonyms of Nb-Feruloyltryptamine are N-Feruloyltryptamine and 3-(4-Hydroxy-3-methoxyphenyl)-N-[2-(1H-indol-3-yl)ethyl]-2-propenamide.

What is the CAS number of Nb-Feruloyltryptamine?

The CAS number of Nb-Feruloyltryptamine is 53905-13-8.

What solvent is used for the melting point determination of Nb-Feruloyltryptamine?

The solvent used for the melting point determination of Nb-Feruloyltryptamine is ethanol.

※ Please kindly note that our products are for research use only.