Nemorensine

Catalog Number	ACM50906962
CAS Number	50906-96-2
Synonyms	(12R,15R)-12,15-Epoxy-1α,2,15,20-tetrahydro-16a-homo-21-norsenecionan-11,16a-dione
Molecular Weight	337.4
InChI	InChI=1S/C18H27NO5/c1-11-8-17(2)9-14(20)23-13-5-7-19-6-4-12(15(13)19)10-22-16(21)18(11,3)24-17/h11-13,15H,4-10H2,1-3H3/t11-,12-,13-,15-,17+,18-/m1/s1
InChI Key	DNEINKNDPRUHLP-WLFFGFHMSA-N
Purity	95%+
Complexity	566
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	337.18892296
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@@H]1C[C@]2(CC(=O)O[C@@H]3CCN4[C@@H]3[C@H](CC4)COC(=O)[C@@]1(O2)C)C
Monoisotopic Mass	337.18892296
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	65.1 Ų

Custom Q&A

What is the chemical name of Nemorensine?

The chemical name of Nemorensine is (12R,15R)-12,15-Epoxy-1α,2,15,20-tetrahydro-16a-homo-21-norsenecionan-11,16a-dione.

What are the synonyms of Nemorensine?

The synonyms of Nemorensine include 4,7-Epoxy-2H-[1,6]dioxacyclotridecino[2,3,4-gh]pyrrolizine-2,8(3H)-dione, dodecahydro-4,6,7-trimethyl-, and (12R,15R)-12,15-Epoxy-1α,2,15,20-tetrahydro-16a-homo-21-norsenecionan-11,16a-dione.

What is the CAS number of Nemorensine?

The CAS number of Nemorensine is 50906-96-2.

What is the molecular formula of Nemorensine?

The molecular formula of Nemorensine is C18H27NO5.

What is the molecular weight of Nemorensine?

The molecular weight of Nemorensine is 337.41 g/mol.

What is the predicted boiling point of Nemorensine?

The predicted boiling point of Nemorensine is 508.4±50.0 °C.

What is the predicted density of Nemorensine?

The predicted density of Nemorensine is 1.24±0.1 g/cm3.

What is the predicted pKa value of Nemorensine?

The predicted pKa value of Nemorensine is 9.22±0.70.

How many carbon atoms are present in the molecular formula of Nemorensine?

There are 18 carbon atoms present in the molecular formula of Nemorensine.

※ Please kindly note that our products are for research use only.