Neoligularidine

Catalog Number	ACM90364913
CAS Number	90364-91-3
Molecular Weight	407.5
InChI	InChI=1S/C21H29NO7/c1-6-15-11-13(2)21(4,29-14(3)23)20(26)27-12-16-7-9-22(5)10-8-17(18(16)24)28-19(15)25/h6-7,13,17H,8-12H2,1-5H3/b15-6-,16-7-/t13-,17-,21+/m1/s1
InChI Key	ZOIAVVNLMDKOIV-JNNPZHNTSA-N
Purity	95%+
Complexity	754
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	407.19440226
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	0
Isomeric SMILES	C/C=C\1/C[C@H]([C@](C(=O)OC/C/2=C/CN(CC[C@H](C2=O)OC1=O)C)(C)OC(=O)C)C
Monoisotopic Mass	407.19440226
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	99.2 Ų

Custom Q&A

What is the product name of the chemical compound with the CAS number 90364-91-3?

The product name is NEOLIGULARIDINE.

What are some synonyms for NEOLIGULARIDINE?

Some synonyms for NEOLIGULARIDINE are 2,9-Dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione and 7-(acetyloxy)-4-ethylidene-6,7,14-trimethyl-, (1R,4Z,6R,7S)-.

What is the molecular formula of NEOLIGULARIDINE?

The molecular formula is C21H29NO7.

What is the molecular weight of NEOLIGULARIDINE?

The molecular weight is 407.46.

What is the chemical structure of NEOLIGULARIDINE?

The chemical structure of NEOLIGULARIDINE is 2,9-Dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione, 7-(acetyloxy)-4-ethylidene-6,7,14-trimethyl-, (1R,4Z,6R,7S)-.

What is the stereochemistry of NEOLIGULARIDINE?

The stereochemistry is (1R,4Z,6R,7S).

What functional groups are present in NEOLIGULARIDINE?

Functional groups present in NEOLIGULARIDINE include acetyloxy, ethylidene, and trimethyl.

In what type of chemical reactions or processes is NEOLIGULARIDINE commonly used?

NEOLIGULARIDINE is commonly used in organic synthesis and chemical research processes.

※ Please kindly note that our products are for research use only.