Neosenkirkine

Catalog Number	ACM57194704
CAS Number	57194-70-4
Synonyms	(15E)-12-Hydroxy-4-methyl-4,8-secosenecionan-8,11,16-trione
Molecular Weight	365.4
InChI	InChI=1S/C19H27NO6/c1-5-13-10-12(2)19(3,24)18(23)25-11-14-6-8-20(4)9-7-15(16(14)21)26-17(13)22/h5-6,12,15,24H,7-11H2,1-4H3/b13-5+,14-6-/t12-,15-,19-/m1/s1
InChI Key	HPDHKHMHQGCNPE-HKZJLVJOSA-N
Purity	95%+
Complexity	652
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	365.18383758
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C/1\C[C@H]([C@@](C(=O)OC/C/2=C/CN(CC[C@H](C2=O)OC1=O)C)(C)O)C
Monoisotopic Mass	365.18383758
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	93.1 Ų

Custom Q&A

What is the chemical formula for NEOSENKIRKINE?

The chemical formula for NEOSENKIRKINE is C19H27NO6.

What is the molecular weight of NEOSENKIRKINE?

The molecular weight of NEOSENKIRKINE is 365.42.

What are some synonyms for NEOSENKIRKINE?

Some synonyms for NEOSENKIRKINE include Crotaverrine and (15E)-12-Hydroxy-4-methyl-4,8-secosenecionan-8,11,16-trione.

What is the predicted boiling point of NEOSENKIRKINE?

The predicted boiling point of NEOSENKIRKINE is 604.9±55.0 °C.

What is the predicted density of NEOSENKIRKINE?

The predicted density of NEOSENKIRKINE is 1.22±0.1 g/cm3.

What is the predicted pka value of NEOSENKIRKINE?

The predicted pka value of NEOSENKIRKINE is 12.67±0.40.

Where is neosenkirkine isolated from?

Neosenkirkine has been isolated from Senecio auricula.

How is the structure of neosenkirkine determined?

The structure of neosenkirkine is based upon chemical and spectroscopic data.

What reference is mentioned for information on neosenkirkine?

The reference mentioned is Martin Panizo, Rodriguez, An. Quirn., 70, 1043 (1974).

How is neosenkirkine synthesized?

Neosenkirkine is synthesized from Senecio auricula.

※ Please kindly note that our products are for research use only.