Neostenine

Neostenine

Inquiry
Catalog Number ACM477953074
CAS Number 477953-07-4
Molecular Weight 277.4
InChI InChI=1S/C17H27NO2/c1-3-11-12-6-4-5-8-18-9-7-13(15(12)18)14-10(2)17(19)20-16(11)14/h10-16H,3-9H2,1-2H3/t10-,11+,12+,13-,14-,15+,16+/m0/s1
InChI Key ROIHYOJMCBKEER-FGBMJVKNSA-N
Purity 95%+
Complexity 410
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 7
Exact Mass 277.204179104
Heavy Atom Count 20
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 0
Isomeric SMILES CC[C@@H]1[C@H]2CCCCN3[C@H]2[C@@H](CC3)[C@H]4[C@@H]1OC(=O)[C@H]4C
Monoisotopic Mass 277.204179104
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 29.5 Ų
Custom Q&A

What is the chemical formula for Neostenine?

The chemical formula for Neostenine is C17H27NO2.

What is the molecular weight of Neostenine?

The molecular weight of Neostenine is 277.4.

What is the CAS number for Neostenine?

The CAS number for Neostenine is 477953-07-4.

What are some synonyms for Neostenine?

Some synonyms for Neostenine include Furo[2,3-h]pyrrolo[3,2,1-jk][1]benzazepin-10(2H)-one, 8-ethyldodecahydro-11-methyl-, and (7aR,8R,8aR,11S,11aR,11bS,11cR)-.

What is the predicted boiling point of Neostenine?

The predicted boiling point of Neostenine is 414.6±45.0 °C.

What is the predicted density of Neostenine?

The predicted density of Neostenine is 1.12±0.1 g/cm3.

What is the predicted pka of Neostenine?

The predicted pka of Neostenine is 9.93±0.60.

How many carbon atoms are in the molecular formula of Neostenine?

There are 17 carbon atoms in the molecular formula of Neostenine.

※ Please kindly note that our products are for research use only.