Neotuberostemonone

Neotuberostemonone

Inquiry
Catalog Number ACM954379681
CAS Number 954379-68-1
Molecular Weight 405.5
InChI InChI=1S/C22H31NO6/c1-4-13-14-7-5-6-8-23(20(14)25)15(17-9-11(2)21(26)28-17)10-16(24)18-12(3)22(27)29-19(13)18/h11-15,17-19H,4-10H2,1-3H3
InChI Key CHQGOWAOLJKTQX-UHFFFAOYSA-N
Purity 95%+
Complexity 720
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 405.21513771
Heavy Atom Count 29
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Monoisotopic Mass 405.21513771
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 90 Ų
Custom Q&A

What is the product name of Neotuberostemone?

The product name of Neotuberostemone is Neotuberostemone.

What are some synonyms of Neotuberostemone?

Some synonyms of Neotuberostemone are NeotuberosteMonone and PubChem ID: 78385648.

What is the CAS number of Neotuberostemone?

The CAS number of Neotuberostemone is 954379-68-1.

What is the molecular formula of Neotuberostemone?

The molecular formula of Neotuberostemone is C22H31NO6.

What is the molecular weight of Neotuberostemone?

The molecular weight of Neotuberostemone is 405.48.

What is the predicted boiling point of Neotuberostemone?

The predicted boiling point of Neotuberostemone is 626.6±55.0 °C.

What is the predicted density of Neotuberostemone?

The predicted density of Neotuberostemone is 1.24±0.1 g/cm3.

What is the predicted pka value of Neotuberostemone?

The predicted pka value of Neotuberostemone is -1.62±0.70.

What is the chemical structure of Neotuberostemone?

The chemical structure of Neotuberostemone is described as 3H-7,12-Methanofuro[3,2-e]azacyclododecine-2,4,14-trione, 13-ethyldecahydro-3-methyl-6-[(2S,4S)-tetrahydro-4-methyl-5-oxo-2-furanyl]-, (3R,3aR,6S,7R,12S,13R,13aR)-.

※ Please kindly note that our products are for research use only.