Norcepharadione b

Catalog Number	ACM57576417
CAS Number	57576-41-7
Synonyms	1,2-Dimethoxy-4H-dibenzo[de,g]quinoline-4,5(6H)-dione
IUPAC Name	Norcepharadione B
Molecular Weight	307.3
Molecular Formula	C18H13NO4
Canonical SMILES	COC1=C(C2=C3C(=C1)C(=O)C(=O)NC3=CC4=CC=CC=C42)OC
InChI	InChI=1S/C18H13NO4/c1-22-13-8-11-14-12(19-18(21)16(11)20)7-9-5-3-4-6-10(9)15(14)17(13)23-2/h3-8H,1-2H3,(H,19,21)
InChI Key	BAGGDUOPTSQTHD-UHFFFAOYSA-N
Melting Point	304-307 °C
Purity	95%+
Density	1.373g/cm³
Complexity	507
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	307.0844579
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	307.0844579
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	64.6 Ų

Custom Q&A

What is the chemical name of Norcepharadione B?

1,2-Dimethoxy-4H-dibenzo[de,g]quinoline-4,5(6H)-dione

What are some synonyms for Norcepharadione B?

Norcepharadione, Norcepharadione B, rcepharadione B

What is the CAS number for Norcepharadione B?

57576-41-7

What is the molecular formula of Norcepharadione B?

C18H13NO4

What is the molecular weight of Norcepharadione B?

307.3

What is the melting point of Norcepharadione B?

304-7°C (dec.)

What is the predicted density of Norcepharadione B?

1.373±0.06 g/cm3

What is the predicted pKa value of Norcepharadione B?

9.90±0.20

In what type of plant can Norcepharadione B be found?

Stephania cephalantha

How is Norcepharadione B separated from other bases in the plant?

By column chromatography

※ Please kindly note that our products are for research use only.