Norchelerythrine

Norchelerythrine

Inquiry
Catalog Number ACM6900998
CAS Number 6900-99-8
Synonyms 1,2-Dimethoxy-[1,3]benzodioxolo[5,6-c]phenanthridine
Molecular Weight 333.3
InChI InChI=1S/C20H15NO4/c1-22-16-6-5-12-13-4-3-11-7-17-18(25-10-24-17)8-14(11)19(13)21-9-15(12)20(16)23-2/h3-9H,10H2,1-2H3
InChI Key JGUNQXPMULKFNY-UHFFFAOYSA-N
Melting Point 221.5-222.5 °C
Purity 95%+
Complexity 488
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 333.10010796
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 333.10010796
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 49.8 Ų
Custom Q&A

What is the chemical formula of Norchelerythrine?

The chemical formula of Norchelerythrine is C20H15NO4.

What is the molecular weight of Norchelerythrine?

The molecular weight of Norchelerythrine is 333.34.

What is the melting point of Norchelerythrine?

The melting point of Norchelerythrine is 221.5-222.5 °C.

In what solvents is Norchelerythrine soluble?

Norchelerythrine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted boiling point of Norchelerythrine?

The predicted boiling point of Norchelerythrine is 554.3±45.0 °C.

What is the form of Norchelerythrine?

Norchelerythrine is in the form of a powder.

What is the predicted pka of Norchelerythrine?

The predicted pka of Norchelerythrine is 3.84±0.20.

What is the target of Norchelerythrine?

The target of Norchelerythrine is antifection.

What is the CAS number of Norchelerythrine?

The CAS number of Norchelerythrine is 6900-99-8.

What is Norchelerythrine classified as in terms of its chemical structure?

Norchelerythrine is classified as a benzophenanthridine alkaloid.

※ Please kindly note that our products are for research use only.