Norglaucin

Catalog Number	ACM21848624
CAS Number	21848-62-4
Structure
Synonyms	(6aS)-5,6,6a,7-Tetrahydro-1,2,9,10-tetramethoxy-4H-dibenzo[de,g]quinoline
Molecular Weight	341.4
InChI	InChI=1S/C20H23NO4/c1-22-15-9-12-7-14-18-11(5-6-21-14)8-17(24-3)20(25-4)19(18)13(12)10-16(15)23-2/h8-10,14,21H,5-7H2,1-4H3/t14-/m0/s1
InChI Key	MZSUVQFIWWXTFR-AWEZNQCLSA-N
Purity	90%+
Complexity	461
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	341.16270821
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	COC1=C(C2=C3[C@H](CC4=CC(=C(C=C42)OC)OC)NCCC3=C1)OC
Monoisotopic Mass	341.16270821
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	49 Ų

Custom Q&A

What is the chemical name of the compound with the synonym Norglaucin?

[6aS,(+)]-5,6,6a,7-Tetrahydro-1,2,9,10-tetramethoxy-4H-dibenzo[de,g]quinoline

What is the molecular formula of Norglaucin?

C20H23NO4

What is the molecular weight of Norglaucin?

341.4

What is the boiling point of Norglaucin?

477.03°C (rough estimate)

How is the color of Norglaucin described?

Noncrystalline solid

What is the predicted pka value of Norglaucin?

7.14±0.20

How is Norglaucin classified in terms of safety profile?

Poison by intravenous and intraperitoneal routes. Moderately toxic by ingestion.

How toxic is Norglaucin with an LD50 value for oral mouse?

450 mg/kg

What is the usage of Norglaucin?

It is an isoquinoline alkaloid.

What toxic fumes does Norglaucin emit when heated to decomposition?

Toxic fumes of NOx.

※ Please kindly note that our products are for research use only.