Norjuziphine

Catalog Number	ACM74119872
CAS Number	74119-87-2
Synonyms	(R)-1,2,3,4-Tetrahydro-1-(4-hydroxybenzyl)-7-methoxyisoquinolin-8-ol
Molecular Weight	285.34
InChI	InChI=1S/C17H19NO3/c1-21-15-7-4-12-8-9-18-14(16(12)17(15)20)10-11-2-5-13(19)6-3-11/h2-7,14,18-20H,8-10H2,1H3/t14-/m1/s1
InChI Key	BXWMZVREXWPYKF-CQSZACIVSA-N
Purity	95%+
Complexity	330
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	285.13649347
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	3
Isomeric SMILES	COC1=C(C2=C(CCN[C@@H]2CC3=CC=C(C=C3)O)C=C1)O
Monoisotopic Mass	285.13649347
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	61.7 Ų

Custom Q&A

What is the chemical formula for norjuziphine?

The chemical formula for norjuziphine is C17H19NO3.

What is the molecular weight of norjuziphine?

The molecular weight of norjuziphine is 285.34.

What is the CAS number for norjuziphine?

The CAS number for norjuziphine is 74119-87-2.

What is the predicted boiling point of norjuziphine?

The predicted boiling point of norjuziphine is 435.8±45.0 °C.

In what solvents is norjuziphine soluble?

Norjuziphine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted pka value of norjuziphine?

The predicted pka value of norjuziphine is 9.93±0.40.

How many carbon atoms are in the molecular structure of norjuziphine?

There are 17 carbon atoms in the molecular structure of norjuziphine.

Can norjuziphine form crystals?

Yes, norjuziphine can form crystals.

What is the predicted density of norjuziphine?

The predicted density of norjuziphine is 1.232±0.06 g/cm3.

What are some synonyms for norjuziphine?

Some synonyms for norjuziphine are (R)-1,2,3,4-Tetrahydro-1-(4-hydroxybenzyl)-7-methoxyisoquinolin-8-ol and 8-Isoquinolinol, 1,2,3,4-tetrahydro-1-[(4-hydroxyphenyl)methyl]-7-methoxy-, (1R)-.

※ Please kindly note that our products are for research use only.