Noroxyhydrastinine

Catalog Number	ACM21796145-1
CAS Number	21796-14-5
Structure
Synonyms	3,4-Dihydro-6,7-methylenedioxy-1(2H)-isoquinolinone
Molecular Weight	191.18
InChI	InChI=1S/C10H9NO3/c12-10-7-4-9-8(13-5-14-9)3-6(7)1-2-11-10/h3-4H,1-2,5H2,(H,11,12)
InChI Key	VSOJKDUWYQCWFM-UHFFFAOYSA-N
Melting Point	189 °C
Purity	95%+
Complexity	256
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	191.058243149
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	191.058243149
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	47.6 Ų

Custom Q&A

What is the chemical name of Noroxyhydrastinine?

The chemical name of Noroxyhydrastinine is 7,8-DIHYDRO-[1,3]DIOXOLO[4,5-G]ISOQUINOLIN-5(6H)-ONE.

What are some synonyms for Noroxyhydrastinine?

Some synonyms for Noroxyhydrastinine are 1,3-Dioxolo(4,5-g)isoquinolin-5(6H)-one, 3,4-Dihydro-6,7-methylenedioxy-1(2H)-isoquinolinone, and NSC 201020.

What is the CAS number for Noroxyhydrastinine?

The CAS number for Noroxyhydrastinine is 21796-14-5.

What is the molecular formula of Noroxyhydrastinine?

The molecular formula of Noroxyhydrastinine is C10H9NO3.

What is the molecular weight of Noroxyhydrastinine?

The molecular weight of Noroxyhydrastinine is 191.18.

What is the melting point of Noroxyhydrastinine?

The melting point of Noroxyhydrastinine is 189°C.

What is the boiling point of Noroxyhydrastinine?

The boiling point of Noroxyhydrastinine is predicted to be 506.6±50.0 °C.

What is the density of Noroxyhydrastinine?

The density of Noroxyhydrastinine is 1.365±0.06 g/cm3 at 20°C and 760 Torr.

What is the pka value of Noroxyhydrastinine?

The pka value of Noroxyhydrastinine is 14.23±0.20.

What is the source of Noroxyhydrastinine and who described it?

Noroxyhydrastinine is an isoquinoline alkaloid from Thalictrum minus var. adiantifolium and it was described by Doskotch and his colleagues.

※ Please kindly note that our products are for research use only.