Nortenuazonic acid

Catalog Number	ACM16820443
CAS Number	16820-44-3
Molecular Weight	183.2
InChI	InChI=1S/C9H13NO3/c1-4(2)7-8(12)6(5(3)11)9(13)10-7/h4,7,12H,1-3H3,(H,10,13)/t7-/m0/s1
InChI Key	JYLWAPLSGOUVIV-ZETCQYMHSA-N
Purity	95%+
Complexity	291
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	183.08954328
Heavy Atom Count	13
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC(C)[C@H]1C(=C(C(=O)N1)C(=O)C)O
Monoisotopic Mass	183.08954328
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	66.4 Ų

Custom Q&A

What is the chemical formula for Nortenuazonic acid?

The chemical formula for Nortenuazonic acid is C9H13NO3.

What is the molecular weight of Nortenuazonic acid?

The molecular weight of Nortenuazonic acid is 183.2.

What is the CAS number for Nortenuazonic acid?

The CAS number for Nortenuazonic acid is 16820-44-3.

What are the synonyms for Nortenuazonic acid?

One synonym for Nortenuazonic acid is 2H-Pyrrol-2-one, 3-acetyl-1,5-dihydro-4-hydroxy-5-(1-methylethyl)-, (S)- (9CI).

What is the predicted boiling point of Nortenuazonic acid?

The predicted boiling point of Nortenuazonic acid is 394.2±42.0 °C.

What is the predicted density of Nortenuazonic acid?

The predicted density of Nortenuazonic acid is 1.214±0.06 g/cm3.

What is the predicted pKa of Nortenuazonic acid?

The predicted pKa of Nortenuazonic acid is 4.50±1.00.

※ Please kindly note that our products are for research use only.