Nortetraphyllicine

Catalog Number	ACM68160769
CAS Number	68160-76-9
Synonyms	(17R,19E)-19,20-Didehydro-1-demethylajmalan-17-ol
IUPAC Name	4-(Decyloxy)-2-hydroxybenzaldehyde
Molecular Weight	294.4
Molecular Formula	C19H22N2O
Canonical SMILES	CC=C1CN2C3CC1C4C2CC5(C3NC6=CC=CC=C65)C4O
InChI	InChI=1S/C19H22N2O/c1-2-10-9-21-14-7-11(10)16-15(21)8-19(18(16)22)12-5-3-4-6-13(12)20-17(14)19/h2-6,11,14-18,20,22H,7-9H2,1H3/b10-2-/t11-,14-,15-,16,17-,18+,19+/m0/s1
InChI Key	HEKXGHRRYWMPER-RWFFMQQTSA-N
Purity	95%+
Complexity	560
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	294.17321333
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C\1/CN2[C@H]3C[C@@H]1C4[C@@H]2C[C@@]5([C@H]3NC6=CC=CC=C65)[C@@H]4O
Monoisotopic Mass	294.17321333
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	35.5 Ų

Custom Q&A

What is the chemical formula of (17R,19E)-19,20-Didehydro-1-demethylajmalan-17-ol?

The chemical formula is C19H22N2O.

What is the molecular weight of (17R,19E)-19,20-Didehydro-1-demethylajmalan-17-ol?

The molecular weight is 294.4 g/mol.

What is the solubility of (17R,19E)-19,20-Didehydro-1-demethylajmalan-17-ol?

It is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

What is the predicted boiling point of (17R,19E)-19,20-Didehydro-1-demethylajmalan-17-ol?

The predicted boiling point is 495.7 ± 45.0 °C.

Where does Nortetraphyllicine come from?

Nortetraphyllicine is a natural product from Rauvolfia verticillata.

What form does (17R,19E)-19,20-Didehydro-1-demethylajmalan-17-ol come in?

It comes in the form of a powder.

Is (17R,19E)-19,20-Didehydro-1-demethylajmalan-17-ol acidic or basic?

It has a predicted pka of 14.42 ± 0.20, suggesting it is acidic.

What are some common solvents that (17R,19E)-19,20-Didehydro-1-demethylajmalan-17-ol is soluble in?

It is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

How is (17R,19E)-19,20-Didehydro-1-demethylajmalan-17-ol commonly used?

It is a natural product used in traditional medicine, specifically from Rauvolfia verticillata.

What is the CAS number for (17R,19E)-19,20-Didehydro-1-demethylajmalan-17-ol?

The CAS number is 68160-76-9.

※ Please kindly note that our products are for research use only.