Nortropacocaine

Catalog Number	ACM18470332
CAS Number	18470-33-2
Structure
Synonyms	3-(8-Azabicyclo[3.2.1]oct-3-yl)benzoic acid
Molecular Weight	231.29
InChI	InChI=1S/C14H17NO2/c16-14(17)10-3-1-2-9(6-10)11-7-12-4-5-13(8-11)15-12/h1-3,6,11-13,15H,4-5,7-8H2,(H,16,17)
InChI Key	HRTCUJBTNCFSIO-UHFFFAOYSA-N
Purity	95%+
Complexity	293
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	231.125928785
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	231.125928785
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	49.3 Ų

Custom Q&A

What is the chemical formula for Nortropacocaine?

The chemical formula for Nortropacocaine is C14H17NO2.

What is the molecular weight of Nortropacocaine?

The molecular weight of Nortropacocaine is 231.29028 g/mol.

What are the synonyms for Nortropacocaine?

The synonyms for Nortropacocaine are 3-(8-azabicyclo[3.2.1]oct-3-yl)benzoic acid and 8-Azabicyclo[3.2.1]octan-3-ol, 3-benzoate, (3-exo)-.

What is the boiling point of Nortropacocaine?

The boiling point of Nortropacocaine is predicted to be 347.5±35.0 °C.

What is the density of Nortropacocaine?

The density of Nortropacocaine is predicted to be 1.17±0.1 g/cm3.

What is the pka value of Nortropacocaine?

The pka value of Nortropacocaine is predicted to be 10.26±0.40.

How is Nortropacocaine predicted to behave at its boiling point?

Nortropacocaine is predicted to boil at 347.5±35.0 °C.

What is the predicted density of Nortropacocaine?

The predicted density of Nortropacocaine is 1.17±0.1 g/cm3.

What is the predicted pka value of Nortropacocaine?

The predicted pka value of Nortropacocaine is 10.26±0.40.

What is the CAS number for Nortropacocaine?

The CAS number for Nortropacocaine is 18470-33-2.

※ Please kindly note that our products are for research use only.