Nortropinyl cinnamate

Catalog Number	ACM126394794
CAS Number	126394-79-4
Synonyms	2-Propenoic acid, 3-phenyl-, 8-azabicyclo[3.2.1]oct-3-yl ester, [1α,3β(E),5α]- (9CI)
Molecular Weight	257.33
InChI	InChI=1S/C16H19NO2/c18-16(9-6-12-4-2-1-3-5-12)19-15-10-13-7-8-14(11-15)17-13/h1-6,9,13-15,17H,7-8,10-11H2/b9-6+/t13-,14+,15
InChI Key	PTRNNLVBSHIELL-BJUVLCKJSA-N
Purity	95%+
Complexity	335
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	257.141578849
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	C1C[C@H]2CC(C[C@@H]1N2)OC(=O)/C=C/C3=CC=CC=C3
Monoisotopic Mass	257.141578849
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	38.3 Ų

Custom Q&A

What is the chemical formula of Nortropinyl cinnamate?

The chemical formula of Nortropinyl cinnamate is C16H19NO2.

What is the molecular weight of Nortropinyl cinnamate?

The molecular weight of Nortropinyl cinnamate is 257.33.

What is the CAS number for Nortropinyl cinnamate?

The CAS number for Nortropinyl cinnamate is 126394-79-4.

What is the boiling point of Nortropinyl cinnamate?

The boiling point of Nortropinyl cinnamate is predicted to be 394.3±35.0 °C.

What is the density of Nortropinyl cinnamate?

The density of Nortropinyl cinnamate is predicted to be 1.15±0.1 g/cm3.

What is the pka value of Nortropinyl cinnamate?

The pka value of Nortropinyl cinnamate is predicted to be 10.06±0.40.

What are some synonyms for Nortropinyl cinnamate?

Some synonyms for Nortropinyl cinnamate are 2-Propenoic acid, 3-phenyl-, 8-azabicyclo[3.2.1]oct-3-yl ester, [1α,3β(E),5α]- (9CI).

What is the predicted boiling point and density of Nortropinyl cinnamate based on the chemical properties?

The predicted boiling point is 394.3±35.0 °C and the predicted density is 1.15±0.1 g/cm3.

What is the importance of knowing the chemical properties of Nortropinyl cinnamate?

Understanding the chemical properties of Nortropinyl cinnamate can be important for various applications in research, pharmaceuticals, or other industries.

※ Please kindly note that our products are for research use only.