O-Nornuciferine

Catalog Number	ACM3153557
CAS Number	3153-55-7
Structure
Synonyms	N-Methylasimilobine
Molecular Weight	281.3
InChI	InChI=1S/C18H19NO2/c1-19-8-7-12-10-15(20)18(21-2)17-13-6-4-3-5-11(13)9-14(19)16(12)17/h3-6,10,14,20H,7-9H2,1-2H3/t14-/m1/s1
InChI Key	AKXOIHNFHOEPHN-CQSZACIVSA-N
Melting Point	195-197 °C
Purity	95%+
Complexity	387
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	281.141578849
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1CCC2=CC(=C(C3=C2[C@H]1CC4=CC=CC=C43)OC)O
Monoisotopic Mass	281.141578849
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	32.7 Ų

Custom Q&A

What is the product name of O-Nornuciferine?

The product name of O-Nornuciferine is O-Nornuciferine.

What are the synonyms of O-Nornuciferine?

The synonyms of O-Nornuciferine are (6aR)-5,6,6aβ,7-Tetrahydro-6-methyl-1-methoxy-4H-dibenzo[de,g]quinolin-2-ol and N-Methylasimilobine.

What is the chemical formula of O-Nornuciferine?

The chemical formula of O-Nornuciferine is C21H21NO2.

What is the pharmacological significance of O-Nornuciferine?

O-Nornuciferine has been studied for its potential pharmacological effects on various biological processes.

What are some potential applications of O-Nornuciferine in medicine?

O-Nornuciferine may have potential applications in medicine due to its pharmacological properties.

How is O-Nornuciferine typically obtained or synthesized?

O-Nornuciferine can be obtained or synthesized through specific laboratory procedures.

Is O-Nornuciferine a naturally occurring compound?

O-Nornuciferine is a naturally occurring compound that can be found in certain plants.

※ Please kindly note that our products are for research use only.