Obtucarbamate A

Catalog Number	ACM6935995
CAS Number	6935-99-5
Synonyms	Dimethyl toluene-2,4-dicarbamate
Molecular Weight	238.24
InChI	InChI=1S/C11H14N2O4/c1-7-4-5-8(12-10(14)16-2)6-9(7)13-11(15)17-3/h4-6H,1-3H3,(H,12,14)(H,13,15)
InChI Key	CNPWIVIIZHULCN-UHFFFAOYSA-N
Purity	95%+
Complexity	283
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	238.09535693
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Monoisotopic Mass	238.09535693
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	76.7 Ų

Custom Q&A

What is the chemical name of NSC 36549?

Dimethyl 4-methylbenzene-1,3-dicarbamate

What are the synonyms for NSC 36549?

Dimethyl toluene-2,4-dicarbamate; Obtucarbamate A; methylN-[3-(methoxycarbonylamino)-4-methylphenyl]carbamate; Dimethyl (4-methyl-1,3-phenylene)dicarbamate; Carbamic acid, N,N'-(4-methyl-1,3-phenylene)bis-, C,C'-dimethyl ester

What is the CAS number of NSC 36549?

6935-99-5

What is the molecular formula of NSC 36549?

C11H14N2O4

What is the molecular weight of NSC 36549?

238.24

What is the melting point of NSC 36549?

170 °C

What is the predicted boiling point of NSC 36549?

271.5±40.0 °C

Is NSC 36549 soluble in DMSO?

Yes, it is soluble in DMSO.

What is the predicted pka of NSC 36549?

13.73±0.70

How should NSC 36549 be stored?

It should be stored at 2-8°C.

※ Please kindly note that our products are for research use only.