Obtucarbamate B

Catalog Number	ACM20913182
CAS Number	20913-18-2
Structure
Synonyms	Dimethyl toluene-2,6-dicarbamate
Molecular Weight	238.24
InChI	InChI=1S/C11H14N2O4/c1-7-8(12-10(14)16-2)5-4-6-9(7)13-11(15)17-3/h4-6H,1-3H3,(H,12,14)(H,13,15)
InChI Key	JNNLWOJZIPJIQG-UHFFFAOYSA-N
Purity	95%+
Complexity	257
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	238.09535693
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Monoisotopic Mass	238.09535693
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	76.7 Ų

Custom Q&A

What is the chemical formula for Dimethyl toluene-2,6-dicarbamate?

The chemical formula for Dimethyl toluene-2,6-dicarbamate is C11H14N2O4.

What is the CAS number for Dimethyl toluene-2,6-dicarbamate?

The CAS number for Dimethyl toluene-2,6-dicarbamate is 20913-18-2.

What is the molecular weight of Dimethyl toluene-2,6-dicarbamate?

The molecular weight of Dimethyl toluene-2,6-dicarbamate is 238.24 g/mol.

What is the predicted melting point of Dimethyl toluene-2,6-dicarbamate?

The predicted melting point of Dimethyl toluene-2,6-dicarbamate is 222-224 °C.

What is the predicted boiling point of Dimethyl toluene-2,6-dicarbamate?

The predicted boiling point of Dimethyl toluene-2,6-dicarbamate is 266.6±40.0 °C.

What is the predicted density of Dimethyl toluene-2,6-dicarbamate?

The predicted density of Dimethyl toluene-2,6-dicarbamate is 1.290±0.06 g/cm3.

What is the predicted pka value of Dimethyl toluene-2,6-dicarbamate?

The predicted pka value of Dimethyl toluene-2,6-dicarbamate is 13.43±0.70.

What are some synonyms for Dimethyl toluene-2,6-dicarbamate?

Some synonyms for Dimethyl toluene-2,6-dicarbamate are 2-Methyl-1,3-phenylenedicarbamic acid methyl ester, Toluene-2,6-bis(methyl) carbamate, Obtucarbamate B, and Dimethyl (2-methyl-1,3-phenylene)dicarbamate.

What is another name for Carbamic acid, N,N'-(2-methyl-1,3-phenylene)bis-, C,C'-dimethyl ester?

Another name for Carbamic acid, N,N'-(2-methyl-1,3-phenylene)bis-, C,C'-dimethyl ester is Dimethyl toluene-2,6-dicarbamate.

※ Please kindly note that our products are for research use only.