Olaquindox

Catalog Number	ACM23696288
CAS Number	23696-28-8
Structure
Synonyms	Bayernox
IUPAC Name	N-(2-Hydroxyethyl)-3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-carboxamide
Molecular Weight	263.25
Molecular Formula	C12H13N3O4
Canonical SMILES	CC1=C([N+](=O)C2=CC=CC=C2N1[O-])C(=O)NCCO
InChI	InChI=1S/C12H13N3O4/c1-8-11(12(17)13-6-7-16)15(19)10-5-3-2-4-9(10)14(8)18/h2-5,16H,6-7H2,1H3,(H,13,17)
InChI Key	TURHTASYUMWZCC-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	421
Exact Mass	263.09060590
Heavy Atom Count	19
Monoisotopic Mass	263.09060590
Topological Polar Surface Area	95.7Ų

Custom Q&A

What is the chemical formula of Olaquindox?

The chemical formula of Olaquindox is C12H13N3O4.

What is the melting point of Olaquindox?

The melting point of Olaquindox is 209°C (dec.).

What is the color of Olaquindox?

The color of Olaquindox is yellow.

How is Olaquindox stored?

Olaquindox is stored at a temperature of 0-6°C.

What is the hazard code for Olaquindox?

The hazard code for Olaquindox is Xn.

What is Olaquindox used for?

Olaquindox is used as an antibacterial growth promoter for pigs.

What are some of the chemical properties of Olaquindox?

Olaquindox is a pale yellow crystalline solid with a slightly solubility in DMSO.

How does Olaquindox affect pregnant rats?

Olaquindox administration to pregnant rats at a dose of 110 mg/kg increases the number of dead fetuses and external deformities in rat pups.

What are some uses of Olaquindox in pig-breeding?

Olaquindox is used as a growth stimulant and as a chemotherapeutic agent to lower the frequency of bacterial enteritis in pigs.

What is Olaquindox classified as by ChEBI?

Olaquindox is classified as a quinoxaline derivative by ChEBI.

※ Please kindly note that our products are for research use only.