Oroidin

Catalog Number	ACM34649224
CAS Number	34649-22-4
Structure
Synonyms	N-[(E)-3-(2-Amino-1H-imidazol-4-yl)-2-propenyl]-4,5-dibromo-1H-pyrrole-2-carboxamide
Molecular Weight	389.05
InChI	InChI=1S/C11H11Br2N5O/c12-7-4-8(18-9(7)13)10(19)15-3-1-2-6-5-16-11(14)17-6/h1-2,4-5,18H,3H2,(H,15,19)(H3,14,16,17)/b2-1+
InChI Key	QKJAXHBFQSBDAR-OWOJBTEDSA-N
Purity	90%+
Complexity	354
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	388.93099
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	4
Isomeric SMILES	C1=C(NC(=C1Br)Br)C(=O)NC/C=C/C2=CN=C(N2)N
Monoisotopic Mass	388.93099
PhysicalState	Solid
Rotatable Bond Count	4
Topological Polar Surface Area	99.6 Ų

Custom Q&A

What is the CAS number for oroidin?

The CAS number for oroidin is 34649-22-4.

What is the molecular formula of oroidin?

The molecular formula of oroidin is C11H11Br2N5O.

What is the molecular weight of oroidin?

The molecular weight of oroidin is 389.05.

Where is oroidin found naturally?

Oroidin is found naturally in Agelas sventres.

What are some synonyms for oroidin?

Some synonyms for oroidin include oroidine and (E)-Oroidin.

What is the chemical structure of oroidin?

The chemical structure of oroidin is N-[(E)-3-(2-Amino-1H-imidazol-4-yl)-2-propenyl]-4,5-dibromo-1H-pyrrole-2-carboxamide.

How is oroidin used in synthesis?

Oroidin is used in chemical synthesis as a natural product.

How is oroidin classified in ChEBI?

Oroidin is classified in ChEBI as a natural product.

※ Please kindly note that our products are for research use only.