Oteromycin

Catalog Number	ACM170591454
CAS Number	170591-45-4
Molecular Weight	487.7
InChI	InChI=1S/C32H41NO3/c1-7-20(2)15-22(4)27-23(5)17-31(6)16-21(3)13-14-26(31)28(27)29(34)25-19-32(36,33-30(25)35)18-24-11-9-8-10-12-24/h7-12,15,17,19,21,26-28,36H,13-14,16,18H2,1-6H3,(H,33,35)/b20-7+,22-15+
InChI Key	LERBUEGMFSDFOI-HNRJQCQOSA-N
Purity	95%+
Complexity	1010
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	487.30864417
Heavy Atom Count	36
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C(\C)/C=C(\C)/C1C(C2CCC(CC2(C=C1C)C)C)C(=O)C3=CC(NC3=O)(CC4=CC=CC=C4)O
Monoisotopic Mass	487.30864417
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	66.4 Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 170591-45-4?

The product name is oteromycin.

What are the synonyms of oteromycin?

One of the synonyms is 2H-Pyrrol-2-one, 3-[[(1S,2R,4aR,6R,8aS)-2-[(1E,3E)-1,3-dimethyl-1,3-pentadien-1-yl]-1,2,4a,5,6,7,8,8a-octahydro-3,4a,6-trimethyl-1-naphthalenyl]carbonyl]-1,5-dihydro-5-hydroxy-5-(phenylmethyl)-, (5S)-.

What is the chemical formula of oteromycin?

The chemical formula is C32H41NO3.

What is the molecular weight of oteromycin?

The molecular weight is 487.67.

What is the primary function of oteromycin?

Oteromycin is a novel antagonist of Endothelin Receptor.

What is the stereochemistry of oteromycin?

Oteromycin has a stereochemistry of (5S)-.

What is the pharmacological action of oteromycin?

Oteromycin acts as an antagonist of Endothelin Receptor.

How does oteromycin work as an Endothelin Receptor antagonist?

Oteromycin binds to the Endothelin Receptor and blocks its activation by endothelin molecules.

What is the potential application of oteromycin in medicine?

Oteromycin may have therapeutic potential in conditions related to endothelin dysregulation, such as hypertension and pulmonary arterial hypertension.

※ Please kindly note that our products are for research use only.