Othonnine

Catalog Number	ACM119565252
CAS Number	119565-25-2
Molecular Weight	353.4
InChI	InChI=1S/C18H27NO6/c1-4-18(23)15(20)13(10(2)3)16(21)25-12-6-8-19-7-5-11(14(12)19)9-24-17(18)22/h5,10,12-15,20,23H,4,6-9H2,1-3H3/t12-,13,14-,15-,18/m1/s1
InChI Key	PHBXHCOARFTKGZ-PGJZFTLKSA-N
Purity	95%+
Complexity	588
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	353.18383758
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	2
Isomeric SMILES	CCC1([C@@H](C(C(=O)O[C@@H]2CCN3[C@@H]2C(=CC3)COC1=O)C(C)C)O)O
Monoisotopic Mass	353.18383758
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	96.3 Ų

Custom Q&A

What is the chemical formula for Othonnine?

The chemical formula for Othonnine is C18H27NO6.

What is the molar mass of Othonnine?

The molar mass of Othonnine is 353.41 g/mol.

What is the CAS number for Othonnine?

The CAS number for Othonnine is 119565-25-2.

What are the synonyms for Othonnine?

The synonyms for Othonnine include 2H-[1,6]Dioxacycloundecino[2,3,4-gh]pyrrolizine-2,6(3H)-dione, 5-ethyl-4,5,8,10,12,13,13a,13b-octahydro-4,5-dihydroxy-3-(1-methylethyl)-, (5R,13aR,13bR)- (9CI).

What is the predicted boiling point of Othonnine?

The predicted boiling point of Othonnine is 559.1±50.0 °C.

What is the predicted density of Othonnine?

The predicted density of Othonnine is 1.29±0.1 g/cm3.

What is the predicted pKa value of Othonnine?

The predicted pKa value of Othonnine is 12.17±0.60.

What is the predicted state of Othonnine at room temperature and pressure?

At room temperature and pressure, Othonnine is likely to be in a solid state.

How many carbon atoms are present in the chemical formula of Othonnine?

There are 18 carbon atoms present in the chemical formula of Othonnine.

What functional groups are present in the chemical structure of Othonnine?

The chemical structure of Othonnine contains hydroxyl, ethyl, and isopropyl functional groups.

※ Please kindly note that our products are for research use only.