Oxoepistephamiersine

Catalog Number	ACM51804683
CAS Number	51804-68-3
Synonyms	3,4,7,8-Tetramethoxy-12-methyl-7,8,9,10-tetrahydro-8a,4b-(epiminoethano)-8,10-epoxyphenanthrene-6,13(5H)-dione
Molecular Weight	403.4
Molecular Formula	C21H25NO7
InChI	InChI=1S/C21H25NO7/c1-22-15(24)10-19-8-12(23)18(27-4)21(28-5)20(19,22)9-14(29-21)11-6-7-13(25-2)17(26-3)16(11)19/h6-7,14,18H,8-10H2,1-5H3/t14-,18+,19,20+,21/m1/s1
InChI Key	UMLCCHVXIGOAFZ-BXPSQMFMSA-N
Purity	95%+
Density	5mg 10mg 20 mg
Complexity	745
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	403.16310214
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1C(=O)CC23[C@]14C[C@H](C5=C2C(=C(C=C5)OC)OC)OC4([C@H](C(=O)C3)OC)OC
Monoisotopic Mass	403.16310214
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	83.5 Ų

Custom Q&A

What is the product name of the chemical compound with CAS number 51804-68-3?

Oxoepistephamiersine

What are the synonyms of Oxoepistephamiersine?

Hasubanan-6,16-dione, 8,10-epoxy-3,4,7,8-tetramethoxy-17-methyl-, (7β,8β,10β)- and 3,4,7,8-tetramethoxy-12-methyl-7,8,9,10-tetrahydro-8a,4b-(epiminoethano)-8,10-epoxyphenanthrene-6,13(5H)-dione

What is the molecular formula of Oxoepistephamiersine?

C21H25NO7

What is the molar mass of Oxoepistephamiersine?

403.43 g/mol

What is the predicted boiling point of Oxoepistephamiersine?

603.9±55.0 °C

In what solvents is Oxoepistephamiersine soluble?

Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the physical form of Oxoepistephamiersine?

Powder

What is the predicted pKa value of Oxoepistephamiersine?

-2.46±0.60

Can Oxoepistephamiersine be dissolved in water?

No, it is not listed as one of the solvents in which it is soluble.

How many methyl groups are present in the molecular structure of Oxoepistephamiersine?

5 methyl groups

※ Please kindly note that our products are for research use only.