Oxyberberine

Oxyberberine

Inquiry
Catalog Number ACM549213-1
CAS Number 549-21-3
Structure
Synonyms Berlambine
Molecular Weight 351.4
InChI InChI=1S/C20H17NO5/c1-23-15-4-3-12-7-14-13-9-17-16(25-10-26-17)8-11(13)5-6-21(14)20(22)18(12)19(15)24-2/h3-4,7-9H,5-6,10H2,1-2H3
InChI Key ZHYQCBCBTQWPLC-UHFFFAOYSA-N
Melting Point 200-201 °C
Purity 95%+
Complexity 607
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 351.11067264
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 351.11067264
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 57.2 Ų
Custom Q&A

What is the chemical formula of Oxyberberine?

The chemical formula of Oxyberberine is C20H17NO5.

What is the molecular weight of Oxyberberine?

The molecular weight of Oxyberberine is 351.35.

What are some synonyms for Oxyberberine?

Some synonyms for Oxyberberine include OXYBERBERIN, ketoberberine, and 8-oxyberberine.

What is the melting point of Oxyberberine?

The melting point of Oxyberberine is 200-201℃.

How is Oxyberberine stored?

Oxyberberine is stored in the refrigerator, under an inert atmosphere.

What are the solubility characteristics of Oxyberberine?

Oxyberberine is slightly soluble in DMSO and Methanol.

What is the primary usage of Oxyberberine?

Oxyberberine is a naturally occurring isoquinoline alkaloid shown to inhibit lipoxygenase and provide antioxidant activity.

What color is Oxyberberine in its solid form?

Oxyberberine is pale yellow to yellow in color in its solid form.

What is the predicted boiling point of Oxyberberine?

The predicted boiling point of Oxyberberine is 611.5±55.0 °C.

What are the chemical properties of Oxyberberine that contribute to its antioxidant activity?

Oxyberberine inhibits lipoxygenase and provides antioxidant activity.

※ Please kindly note that our products are for research use only.