Palmatine chloride hydrate

Catalog Number	ACM207605365
CAS Number	207605-36-5
Structure
Description	Palmatine chloride hydrate is a chemical compound that is used as an analytical reagent in chromatographic and spectroscopic methods. It has been shown to have toxicological effects on animals, including the inhibition of uptake of nitrogen atoms and statistically significant changes in the levels of dyebath, nmr spectra, single-stranded DNA, and solution form. Palmatine chloride hydrate is also used in analytical chemistry as a dyeing agent for alizarin.
Synonyms	2,3,9,10-Tetramethoxyprotoberberinchloride hydrate
Molecular Weight	387.86 g/mol
Molecular Formula	C21H22NO4Cl·xH2O
Canonical SMILES	COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)OC.O.[Cl-]
Storage	store at <-15℃
Harmonized Tariff Code	Switzerland: 29334900 - USA: 2933492600 - Slovakia: 2933490000 - UK: 2933499000 - China: 2933490099
MDL Number	MFCD00016656

Custom Q&A

What is the chemical formula of Palmatine chloride hydrate?

The chemical formula of Palmatine chloride hydrate is C21H24ClNO5.

What is the molecular weight of Palmatine chloride hydrate?

The molecular weight of Palmatine chloride hydrate is 405.87.

What are the synonyms of Palmatine chloride hydrate?

The synonyms of Palmatine chloride hydrate include BUFFER SP2, KIT DNA/RNA EZ-96 1X96 TESTS, and Hydrochloric PalMatine.

What is the melting point of Palmatine chloride hydrate?

The melting point of Palmatine chloride hydrate is 206-207 °C (dec.)(lit.).

What is the hazard code associated with Palmatine chloride hydrate?

The hazard code associated with Palmatine chloride hydrate is Xn.

What are the safety statements related to Palmatine chloride hydrate?

The safety statements related to Palmatine chloride hydrate include 24 and 45.

What is the common usage of Palmatine chloride hydrate?

Palmatine chloride hydrate is commonly used as an alkaloid standard in the method validation for determination of berberine, hydrastine and canadine in goldenseal root powder.

What is the general description of Palmatine chloride hydrate?

Palmatine chloride hydrate is an alkaloid with potential phototoxic properties and low quantum yields for fluorescence.

In what study has Palmatine chloride hydrate been used?

Palmatine chloride hydrate has been used in a study investigating the FT-Raman and surface-enhanced Raman scattering spectra of palmatine, jatrorrhizine, and coptisine.

What are the product categories that Palmatine chloride hydrate falls under?

Palmatine chloride hydrate falls under product categories such as Building Blocks, Chemical Synthesis, Heterocyclic Building Blocks, and Isoquinolines.

※ Please kindly note that our products are for research use only.