Palmatrubine

Palmatrubine

Inquiry
Catalog Number ACM16176684
CAS Number 16176-68-4
Structure
Synonyms 2,3,10-Trimethoxy-5,6-dihydrodibenzo[a,g]quinolizinium-9-ol
Molecular Weight 338.4
InChI InChI=1S/C20H19NO4/c1-23-17-5-4-12-8-16-14-10-19(25-3)18(24-2)9-13(14)6-7-21(16)11-15(12)20(17)22/h4-5,8-11H,6-7H2,1-3H3/p+1
InChI Key QBUIDYLGKMWNEA-UHFFFAOYSA-O
Purity 95%+
Complexity 461
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 338.13923312
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 4
Hydrogen Bond Donor Count 1
Monoisotopic Mass 338.13923312
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 51.8 Ų
Custom Q&A

What is the chemical structure of Palmatrubine?

The chemical structure of Palmatrubine is 2,3,10-Trimethoxy-5,6-dihydrodibenzo[a,g]quinolizinium-9-ol.

What are some synonyms for Palmatrubine?

Some synonyms for Palmatrubine include Palmatrubin, Palmaturbine, 5,6-Dihydro-9-hydroxy-2,3,10-trimethoxydibenzo[a,g]quinolizinium, and Patrilineal.

What is the CAS number for Palmatrubine?

The CAS number for Palmatrubine is 16176-68-4.

What is the molecular formula of Palmatrubine?

The molecular formula of Palmatrubine is C20H20NO4.

What is the main usage of Palmatrubine?

Palmatrubine is used as a novel inhibitor, a tetrahydroprotoberberine acting as an inhibitor of tissue factor procoagulant.

How does Palmatrubine function as an inhibitor?

Palmatrubine acts as an inhibitor of tissue factor procoagulant.

What type of compound is Palmatrubine classified as?

Palmatrubine is classified as a tetrahydroprotoberberine.

※ Please kindly note that our products are for research use only.