Palonosetron hydrochloride

Catalog Number	ACM135729623
CAS Number	135729-62-3
Structure
Synonyms	Aloxi
IUPAC Name	(3aS)-2-[(3S)-1-Azabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydro-3H-benzo[de]isoquinolin-1-one;hydrochloride
Molecular Weight	332.87
Molecular Formula	C19H25ClN2O
Canonical SMILES	C1CC2CN(C(=O)C3=CC=CC(=C23)C1)C4CN5CCC4CC5.Cl
InChI	InChI=1S/C19H24N2O.ClH/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-21(19)17-12-20-9-7-13(17)8-10-20;/h2,4,6,13,15,17H,1,3,5,7-12H2;1H/t15-,17-;/m1./s1
InChI Key	OLDRWYVIKMSFFB-SSPJITILSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	456
Exact Mass	332.1655411
Heavy Atom Count	23
Isomeric SMILES	C1C[C@@H]2CN(C(=O)C3=CC=CC(=C23)C1)[C@@H]4CN5CCC4CC5.Cl
Monoisotopic Mass	332.1655411
Topological Polar Surface Area	23.6Ų

Custom Q&A

What is the chemical formula for Palonosetron Hydrochloride?

The chemical formula for Palonosetron Hydrochloride is C19H25ClN2O.

What is the molecular weight of Palonosetron Hydrochloride?

The molecular weight of Palonosetron Hydrochloride is 332.87.

What is the melting point of Palonosetron Hydrochloride?

The melting point of Palonosetron Hydrochloride is >290°C.

What are the common adverse effects of Palonosetron Hydrochloride?

The most common adverse effects of Palonosetron Hydrochloride are headache and constipation.

What are the synonyms for Palonosetron Hydrochloride?

The synonyms for Palonosetron Hydrochloride include Palonosetron HCL, CS-292, and Palonosetronhydrochloride hydrochloride.

How is Palonosetron Hydrochloride used in clinical treatment?

Palonosetron Hydrochloride is used as a drug to inhibit nausea and vomiting, particularly in acute severe emetogenic chemotherapy induced delayed nausea and vomiting.

What is the recommended dosage of Palonosetron Hydrochloride?

The recommended dosage of Palonosetron Hydrochloride is 0.25 mg, administered as a single intravenous dose approximately 30 minutes before the start of chemotherapy.

How does Palonosetron Hydrochloride work in the body?

Palonosetron Hydrochloride is a 5-HT3 receptor antagonist that can block the vomiting reflex center peripheral neurons presynaptic 5-HT, reducing the incidence of nausea and vomiting.

What is the originator of Palonosetron Hydrochloride?

Syntex (Roche Bioscience) is the originator of Palonosetron Hydrochloride.

What is the brand name of Palonosetron Hydrochloride?

The brand name of Palonosetron Hydrochloride is Aloxi.

※ Please kindly note that our products are for research use only.