Pandamarilactonine b

Catalog Number	ACM303008813
CAS Number	303008-81-3
Molecular Weight	317.4
Molecular Formula	C18H23NO4
InChI	InChI=1S/C18H23NO4/c1-12-10-14(22-17(12)20)6-3-4-8-19-9-5-7-15(19)16-11-13(2)18(21)23-16/h6,10-11,15-16H,3-5,7-9H2,1-2H3/b14-6-/t15-,16+/m0/s1
InChI Key	HSICZNIIIPFAAO-VFPQPWSNSA-N
Density	5mg 10mg 20 mg
Complexity	602
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	317.16270821
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Isomeric SMILES	CC1=C[C@@H](OC1=O)[C@@H]2CCCN2CCC/C=C\3/C=C(C(=O)O3)C
Monoisotopic Mass	317.16270821
PhysicalState	Oil
Rotatable Bond Count	5
Topological Polar Surface Area	55.8 Ų

Custom Q&A

What is the chemical name of Pandamarilactonine B?

The chemical name of Pandamarilactonine B is 2(5H)-Furanone, 5-[4-[(2R)-2-[(2S)-2,5-dihydro-4-methyl-5-oxo-2-furanyl]-1-pyrrolidinyl]butylidene]-3-methyl-, (5Z)-rel-

What is the molecular formula of Pandamarilactonine B?

The molecular formula of Pandamarilactonine B is C18H23NO4

What is the molecular weight of Pandamarilactonine B?

The molecular weight of Pandamarilactonine B is 317.38

What is the CAS number of Pandamarilactonine B?

The CAS number of Pandamarilactonine B is 303008-81-3

What are some synonyms for Pandamarilactonine B?

Some synonyms for Pandamarilactonine B include Pandamarilactonine B and 2(5H)-Furanone, 5-[4-[(2R)-2-[(2S)-2,5-dihydro-4-methyl-5-oxo-2-furanyl]-1-pyrrolidinyl]butylidene]-3-methyl-, (5Z)-rel-

What is the structure of Pandamarilactonine B?

The structure of Pandamarilactonine B is a furanone molecule with a pyrrolidinyl group and a butylidene group.

What is the stereochemistry of Pandamarilactonine B?

The stereochemistry of Pandamarilactonine B is (5Z)-rel-

What type of compound is Pandamarilactonine B?

Pandamarilactonine B is a lactone compound.

※ Please kindly note that our products are for research use only.