Paniculidine B

Catalog Number	ACM97399945
CAS Number	97399-94-5
Synonyms	(2R)-4-(1-Methoxyindol-3-yl)-2-methylbutan-1-ol
Molecular Weight	233.31
InChI	InChI=1S/C14H19NO2/c1-11(10-16)7-8-12-9-15(17-2)14-6-4-3-5-13(12)14/h3-6,9,11,16H,7-8,10H2,1-2H3/t11-/m1/s1
InChI Key	FGYVMFMFZWJGDY-LLVKDONJSA-N
Purity	95%+
Complexity	234
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	233.141578849
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H](CCC1=CN(C2=CC=CC=C21)OC)CO
Monoisotopic Mass	233.141578849
PhysicalState	Oil
Rotatable Bond Count	5
Topological Polar Surface Area	34.4 Ų

Custom Q&A

What is the chemical formula of Paniculidine B?

The chemical formula of Paniculidine B is C14H19NO2.

What is the molecular weight of Paniculidine B?

The molecular weight of Paniculidine B is 233.31.

What is the CAS number of Paniculidine B?

The CAS number of Paniculidine B is 97399-94-5.

What is the predicted boiling point of Paniculidine B?

The predicted boiling point of Paniculidine B is 384.8±44.0 °C.

In what solvents is Paniculidine B soluble?

Paniculidine B is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What form is Paniculidine B in?

Paniculidine B is in the form of oil.

What is the predicted density of Paniculidine B?

The predicted density of Paniculidine B is 1.09±0.1 g/cm3.

What is the predicted pKa value of Paniculidine B?

The predicted pKa value of Paniculidine B is 15.00±0.10.

Can Paniculidine B be classified as an alcohol?

Yes, Paniculidine B can be classified as an alcohol based on its chemical structure.

Are there any known synonyms for Paniculidine B?

Yes, some known synonyms for Paniculidine B include 1H-Indole-3-butanol, 1-methoxy-α-methyl-, and (βR)-1H-Indole-3-butanol, 1-methoxy-β-methyl-.

※ Please kindly note that our products are for research use only.