Parsonsine

Catalog Number	ACM72213980
CAS Number	72213-98-0
Molecular Weight	439.5
InChI	InChI=1S/C22H33NO8/c1-12(2)21(27)10-17(24)30-14(5)22(28,13(3)4)20(26)29-11-15-6-8-23-9-7-16(18(15)23)31-19(21)25/h6,12-14,16,18,27-28H,7-11H2,1-5H3/t14-,16-,18-,21+,22+/m1/s1
InChI Key	MPPSDVYCCOJJIB-QCNRXRGQSA-N
Purity	95%+
Complexity	778
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	439.22061701
Heavy Atom Count	31
Hydrogen Bond Acceptor Count	9
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@@H]1[C@](C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC(=O)[C@](CC(=O)O1)(C(C)C)O)(C(C)C)O
Monoisotopic Mass	439.22061701
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	123 Ų

Custom Q&A

What is the chemical name of Parsonsine?

The chemical name of Parsonsine is 7H-[1,5,10]Trioxacyclotetradecino[7,8,9-gh]pyrrolizine-2,5,9(8H)-trione, 3,4,11,13,15,16,16a,16b-octahydro-3,8-dihydroxy-7-methyl-3,8-bis(1-methylethyl)-, (3S,7R,8S,16aR,16bR)-.

What is the CAS number of Parsonsine?

The CAS number of Parsonsine is 72213-98-0.

What is the molecular formula of Parsonsine?

The molecular formula of Parsonsine is C22H33NO8.

What is the molecular weight of Parsonsine?

The molecular weight of Parsonsine is 439.5.

What is the predicted boiling point of Parsonsine?

The predicted boiling point of Parsonsine is 674.5±55.0 °C.

What is the predicted density of Parsonsine?

The predicted density of Parsonsine is 1.29±0.1 g/cm3.

What is the predicted pka value of Parsonsine?

The predicted pka value of Parsonsine is 11.51±0.60.

How is Parsonsine defined in ChEBI?

Parsonsine is defined as a macrotriolide in ChEBI.

What are some synonyms of Parsonsine?

Some synonyms of Parsonsine include Parsonsine; 7H-[1,5,10]Trioxacyclotetradecino[7,8,9-gh]pyrrolizine-2,5,9(8H)-trione, 3,4,11,13,15,16,16a,16b-octahydro-3,8-dihydroxy-7-methyl-3,8-bis(1-methylethyl)-, (3S,7R,8S,16aR,16bR)-.

※ Please kindly note that our products are for research use only.