Pedatisectine F

Catalog Number	ACM206757326
CAS Number	206757-32-6
Molecular Weight	214.22
Molecular Formula	C9H14N2O4
InChI	InChI=1S/C9H14N2O4/c1-5-2-10-3-6(11-5)8(14)9(15)7(13)4-12/h2-3,7-9,12-15H,4H2,1H3
InChI Key	JHZAQNFLUSEYDA-UHFFFAOYSA-N
Purity	95%+
Density	5mg 10mg 20 mg
Complexity	193
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	214.09535693
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	4
Monoisotopic Mass	214.09535693
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	107 Ų

Custom Q&A

What is the chemical formula of pedatisectine F?

The chemical formula of pedatisectine F is C9H14N2O4.

What is the molecular weight of pedatisectine F?

The molecular weight of pedatisectine F is 214.22.

What are some synonyms for pedatisectine F?

Some synonyms for pedatisectine F include 1,2,3,4-Butanetetrol, 1-(6-methyl-2-pyrazinyl)- and 2-Methyl-6-(1,2,3,4-tetrahydroxybutyl)pyrazine.

What is the CAS number for pedatisectine F?

The CAS number for pedatisectine F is 206757-32-6.

What is the predicted boiling point of pedatisectine F?

The predicted boiling point of pedatisectine F is 529.2±50.0 °C.

What is the predicted density of pedatisectine F?

The predicted density of pedatisectine F is 1.432±0.06 g/cm3.

What is the predicted pka value of pedatisectine F?

The predicted pka value of pedatisectine F is 12.66±0.20.

What is the structure of pedatisectine F?

The structure of pedatisectine F contains a pyrazine ring connected to a tetrahydroxybutyl group.

※ Please kindly note that our products are for research use only.